|
Name |
Solanapyrone P
|
Molecular Formula | C16H22O3 | |
IUPAC Name* |
6-[(1R,2S,4aR,6R,8aR)-6-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2,3-dihydropyran-4-one
|
|
SMILES |
C[C@H]1C=C[C@H]2C[C@@H](CC[C@H]2[C@@H]1C3=CC(=O)CCO3)O
|
|
InChI |
InChI=1S/C16H22O3/c1-10-2-3-11-8-12(17)4-5-14(11)16(10)15-9-13(18)6-7-19-15/h2-3,9-12,14,16-17H,4-8H2,1H3/t10-,11-,12+,14+,16+/m0/s1
|
|
InChIKey |
LUYYXPOZFWRTEE-HCBXJVOMSA-N
|
|
Synonyms |
Solanapyrone P
|
|
CAS | NA | |
PubChem CID | 139588021 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 262.34 | ALogp: | 1.8 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.738 |
Caco-2 Permeability: | -4.749 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.126 | Pgp-substrate: | 0.97 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.114 |
30% Bioavailability (F30%): | 0.078 |
Blood-Brain-Barrier Penetration (BBB): | 0.908 | Plasma Protein Binding (PPB): | 64.45% |
Volume Distribution (VD): | 1.17 | Fu: | 24.40% |
CYP1A2-inhibitor: | 0.173 | CYP1A2-substrate: | 0.142 |
CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.745 |
CYP2C9-inhibitor: | 0.055 | CYP2C9-substrate: | 0.064 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.04 |
CYP3A4-inhibitor: | 0.675 | CYP3A4-substrate: | 0.675 |
Clearance (CL): | 12.55 | Half-life (T1/2): | 0.858 |
hERG Blockers: | 0.058 | Human Hepatotoxicity (H-HT): | 0.207 |
Drug-inuced Liver Injury (DILI): | 0.825 | AMES Toxicity: | 0.071 |
Rat Oral Acute Toxicity: | 0.29 | Maximum Recommended Daily Dose: | 0.963 |
Skin Sensitization: | 0.85 | Carcinogencity: | 0.175 |
Eye Corrosion: | 0.934 | Eye Irritation: | 0.981 |
Respiratory Toxicity: | 0.971 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003756 | 0.395 | D00YWP | 0.291 | ||||
ENC005098 | 0.375 | D04SFH | 0.284 | ||||
ENC003784 | 0.375 | D06XMU | 0.270 | ||||
ENC003460 | 0.375 | D0I2SD | 0.258 | ||||
ENC002215 | 0.375 | D0Z1FX | 0.256 | ||||
ENC002108 | 0.365 | D0F1UL | 0.255 | ||||
ENC002059 | 0.361 | D0I1LH | 0.248 | ||||
ENC000866 | 0.349 | D02KIU | 0.247 | ||||
ENC000978 | 0.341 | D0GL7U | 0.247 | ||||
ENC003708 | 0.337 | D0D2TN | 0.245 |