|
Name |
solanapyrone C
|
Molecular Formula | C19H25NO4 | |
IUPAC Name* |
6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-(2-hydroxyethylamino)-2-oxopyran-3-carbaldehyde
|
|
SMILES |
C[C@H]1C=C[C@H]2CCCC[C@H]2[C@@H]1C3=CC(=C(C(=O)O3)C=O)NCCO
|
|
InChI |
InChI=1S/C19H25NO4/c1-12-6-7-13-4-2-3-5-14(13)18(12)17-10-16(20-8-9-21)15(11-22)19(23)24-17/h6-7,10-14,18,20-21H,2-5,8-9H2,1H3/t12-,13+,14+,18+/m0/s1
|
|
InChIKey |
FDLXGUBSZCJEGE-HNSFDTNUSA-N
|
|
Synonyms |
solanapyrone C; 88899-59-6; 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-(2-hydroxyethylamino)-2-oxopyran-3-carbaldehyde; 4-[(2-hydroxyethyl)amino]-6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-oxo-2H-pyran-3-carbaldehyde; CHEBI:38239; DTXSID501008563; 6-((1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-4-(2-hydroxyethylamino)-2-oxo-pyran-3-carbaldehyde; Q27117419; 4-[(2-Hydroxyethyl)amino]-6-(2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-2-oxo-2H-pyran-3-carbaldehyde
|
|
CAS | 88899-59-6 | |
PubChem CID | 181959 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 331.4 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.634 |
Caco-2 Permeability: | -5.016 | MDCK Permeability: | 0.00007090 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.472 |
Human Intestinal Absorption (HIA): | 0.667 | 20% Bioavailability (F20%): | 0.163 |
30% Bioavailability (F30%): | 0.572 |
Blood-Brain-Barrier Penetration (BBB): | 0.495 | Plasma Protein Binding (PPB): | 92.76% |
Volume Distribution (VD): | 1.721 | Fu: | 5.77% |
CYP1A2-inhibitor: | 0.808 | CYP1A2-substrate: | 0.676 |
CYP2C19-inhibitor: | 0.157 | CYP2C19-substrate: | 0.589 |
CYP2C9-inhibitor: | 0.522 | CYP2C9-substrate: | 0.15 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.334 |
CYP3A4-inhibitor: | 0.886 | CYP3A4-substrate: | 0.156 |
Clearance (CL): | 3.107 | Half-life (T1/2): | 0.137 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.626 |
Drug-inuced Liver Injury (DILI): | 0.766 | AMES Toxicity: | 0.038 |
Rat Oral Acute Toxicity: | 0.149 | Maximum Recommended Daily Dose: | 0.444 |
Skin Sensitization: | 0.51 | Carcinogencity: | 0.582 |
Eye Corrosion: | 0.086 | Eye Irritation: | 0.186 |
Respiratory Toxicity: | 0.937 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002059 | 0.716 | D07GRH | 0.236 | ||||
ENC000866 | 0.688 | D0U0XD | 0.216 | ||||
ENC003708 | 0.684 | D0I0DQ | 0.214 | ||||
ENC002108 | 0.605 | D00ZFP | 0.214 | ||||
ENC003756 | 0.500 | D0I5DS | 0.205 | ||||
ENC003771 | 0.341 | D0T0LU | 0.204 | ||||
ENC003767 | 0.328 | D0IL7L | 0.198 | ||||
ENC001414 | 0.297 | D0D1SG | 0.198 | ||||
ENC001860 | 0.265 | D0W8SB | 0.198 | ||||
ENC002200 | 0.258 | D04UZT | 0.197 |