|
Name |
Phomopene
|
Molecular Formula | C10H18O3 | |
IUPAC Name* |
(1S,2R,5R,6S)-5-(2-hydroxypropan-2-yl)-2-methyl-7-oxabicyclo[4.1.0]heptan-2-ol
|
|
SMILES |
C[C@]1(CC[C@H]([C@H]2[C@@H]1O2)C(C)(C)O)O
|
|
InChI |
InChI=1S/C10H18O3/c1-9(2,11)6-4-5-10(3,12)8-7(6)13-8/h6-8,11-12H,4-5H2,1-3H3/t6-,7+,8+,10-/m1/s1
|
|
InChIKey |
DRAPOCVWVCKZRC-CHIQAWFVSA-N
|
|
Synonyms |
Phomopene
|
|
CAS | NA | |
PubChem CID | 139584698 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.25 | ALogp: | 0.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 53.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 13 | QED Weighted: | 0.603 |
Caco-2 Permeability: | -4.369 | MDCK Permeability: | 0.00001810 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.048 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.911 | Plasma Protein Binding (PPB): | 45.96% |
Volume Distribution (VD): | 0.993 | Fu: | 53.64% |
CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.384 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.756 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.109 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.193 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.206 |
Clearance (CL): | 6.156 | Half-life (T1/2): | 0.704 |
hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.094 |
Drug-inuced Liver Injury (DILI): | 0.068 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.257 | Maximum Recommended Daily Dose: | 0.014 |
Skin Sensitization: | 0.233 | Carcinogencity: | 0.152 |
Eye Corrosion: | 0.902 | Eye Irritation: | 0.975 |
Respiratory Toxicity: | 0.317 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002827 | 0.397 | D07QKN | 0.375 | ||||
ENC002289 | 0.397 | D0N6FH | 0.200 | ||||
ENC004622 | 0.386 | D04CSZ | 0.189 | ||||
ENC002249 | 0.386 | D0H1QY | 0.189 | ||||
ENC004617 | 0.386 | D02VPX | 0.188 | ||||
ENC002248 | 0.386 | D0U3GL | 0.188 | ||||
ENC004616 | 0.386 | D0K7LU | 0.186 | ||||
ENC005561 | 0.385 | D0G6AB | 0.185 | ||||
ENC004079 | 0.379 | D0T2PL | 0.184 | ||||
ENC004067 | 0.379 | D05BTM | 0.184 |