|
Name |
Redoxcitrinin
|
Molecular Formula | C13H16O4 | |
IUPAC Name* |
2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxobutan-2-yl]benzaldehyde
|
|
SMILES |
CC1=C(C(=C(C(=C1O)C)O)C=O)[C@H](C)C(=O)C
|
|
InChI |
InChI=1S/C13H16O4/c1-6(9(4)15)11-7(2)12(16)8(3)13(17)10(11)5-14/h5-6,16-17H,1-4H3/t6-/m1/s1
|
|
InChIKey |
CBUOBMSAFIYYEJ-ZCFIWIBFSA-N
|
|
Synonyms |
Redoxcitrinin; Q63392268
|
|
CAS | NA | |
PubChem CID | 137628353 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.26 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.791 |
Caco-2 Permeability: | -4.745 | MDCK Permeability: | 0.00000817 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.526 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.672 |
30% Bioavailability (F30%): | 0.037 |
Blood-Brain-Barrier Penetration (BBB): | 0.502 | Plasma Protein Binding (PPB): | 97.01% |
Volume Distribution (VD): | 0.676 | Fu: | 1.74% |
CYP1A2-inhibitor: | 0.208 | CYP1A2-substrate: | 0.918 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.755 |
CYP2C9-inhibitor: | 0.083 | CYP2C9-substrate: | 0.873 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.237 |
CYP3A4-inhibitor: | 0.104 | CYP3A4-substrate: | 0.279 |
Clearance (CL): | 9.367 | Half-life (T1/2): | 0.836 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.134 |
Drug-inuced Liver Injury (DILI): | 0.075 | AMES Toxicity: | 0.048 |
Rat Oral Acute Toxicity: | 0.084 | Maximum Recommended Daily Dose: | 0.659 |
Skin Sensitization: | 0.748 | Carcinogencity: | 0.09 |
Eye Corrosion: | 0.902 | Eye Irritation: | 0.942 |
Respiratory Toxicity: | 0.608 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005368 | 0.460 | D06JGH | 0.250 | ||||
ENC002391 | 0.444 | D0L5FY | 0.247 | ||||
ENC001359 | 0.423 | D0WY9N | 0.236 | ||||
ENC001498 | 0.407 | D05QDC | 0.230 | ||||
ENC003354 | 0.407 | D0JO3U | 0.222 | ||||
ENC006056 | 0.387 | D0Y7PG | 0.213 | ||||
ENC001496 | 0.386 | D00FSV | 0.207 | ||||
ENC004139 | 0.373 | D09EBS | 0.205 | ||||
ENC004249 | 0.371 | D0B1IP | 0.202 | ||||
ENC004879 | 0.367 | D0O6KE | 0.200 |