|
Name |
Penibenzone C
|
Molecular Formula | C10H8O5 | |
IUPAC Name* |
5,7-dihydroxy-6-methyl-1-oxo-3H-2-benzofuran-4-carbaldehyde
|
|
SMILES |
CC1=C(C(=C2COC(=O)C2=C1O)C=O)O
|
|
InChI |
InChI=1S/C10H8O5/c1-4-8(12)5(2-11)6-3-15-10(14)7(6)9(4)13/h2,12-13H,3H2,1H3
|
|
InChIKey |
IOXSICGHBRRIGT-UHFFFAOYSA-N
|
|
Synonyms |
Penibenzone C
|
|
CAS | NA | |
PubChem CID | 129710572 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.17 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.537 |
Caco-2 Permeability: | -5.119 | MDCK Permeability: | 0.00000444 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.039 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.023 | Plasma Protein Binding (PPB): | 97.75% |
Volume Distribution (VD): | 0.524 | Fu: | 5.50% |
CYP1A2-inhibitor: | 0.579 | CYP1A2-substrate: | 0.134 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.164 | CYP2C9-substrate: | 0.314 |
CYP2D6-inhibitor: | 0.069 | CYP2D6-substrate: | 0.168 |
CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.05 |
Clearance (CL): | 10.471 | Half-life (T1/2): | 0.873 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.056 |
Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.111 |
Rat Oral Acute Toxicity: | 0.285 | Maximum Recommended Daily Dose: | 0.257 |
Skin Sensitization: | 0.755 | Carcinogencity: | 0.85 |
Eye Corrosion: | 0.853 | Eye Irritation: | 0.9 |
Respiratory Toxicity: | 0.804 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003029 | 0.674 | D04FBR | 0.283 | ||||
ENC003016 | 0.604 | D06JGH | 0.262 | ||||
ENC002023 | 0.571 | D07MGA | 0.202 | ||||
ENC004984 | 0.571 | D0Y7PG | 0.190 | ||||
ENC004506 | 0.571 | D02PMO | 0.189 | ||||
ENC005913 | 0.569 | D0Z4XW | 0.187 | ||||
ENC004362 | 0.569 | D05VLS | 0.186 | ||||
ENC004504 | 0.538 | D0YH0N | 0.185 | ||||
ENC002722 | 0.538 | D07AHW | 0.183 | ||||
ENC001919 | 0.509 | D0H6QU | 0.183 |