|
Name |
Spoxazomicin C
|
Molecular Formula | C10H11NO3 | |
IUPAC Name* |
2-[4-(hydroxymethyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol
|
|
SMILES |
C1C(N=C(O1)C2=CC=CC=C2O)CO
|
|
InChI |
InChI=1S/C10H11NO3/c12-5-7-6-14-10(11-7)8-3-1-2-4-9(8)13/h1-4,7,12-13H,5-6H2
|
|
InChIKey |
KSWPNAGSVMAXMO-UHFFFAOYSA-N
|
|
Synonyms |
Spoxazomicin C
|
|
CAS | NA | |
PubChem CID | 136065872 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 193.2 | ALogp: | 0.5 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 62.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.734 |
Caco-2 Permeability: | -4.619 | MDCK Permeability: | 0.00003090 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.136 | Plasma Protein Binding (PPB): | 59.79% |
Volume Distribution (VD): | 1.264 | Fu: | 42.94% |
CYP1A2-inhibitor: | 0.807 | CYP1A2-substrate: | 0.305 |
CYP2C19-inhibitor: | 0.045 | CYP2C19-substrate: | 0.465 |
CYP2C9-inhibitor: | 0.05 | CYP2C9-substrate: | 0.572 |
CYP2D6-inhibitor: | 0.107 | CYP2D6-substrate: | 0.231 |
CYP3A4-inhibitor: | 0.027 | CYP3A4-substrate: | 0.264 |
Clearance (CL): | 7.315 | Half-life (T1/2): | 0.752 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.401 |
Drug-inuced Liver Injury (DILI): | 0.678 | AMES Toxicity: | 0.202 |
Rat Oral Acute Toxicity: | 0.112 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.369 | Carcinogencity: | 0.061 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.618 |
Respiratory Toxicity: | 0.724 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001378 | 0.778 | D07HBX | 0.340 | ||||
ENC003600 | 0.438 | D05OIS | 0.286 | ||||
ENC003518 | 0.438 | D0F5ZM | 0.281 | ||||
ENC005498 | 0.388 | D0R8PX | 0.266 | ||||
ENC000754 | 0.388 | D0D5GG | 0.262 | ||||
ENC000021 | 0.378 | D09ZIS | 0.254 | ||||
ENC003520 | 0.367 | D0A5CM | 0.253 | ||||
ENC000028 | 0.348 | D06BQU | 0.250 | ||||
ENC000409 | 0.346 | D03GET | 0.246 | ||||
ENC002244 | 0.340 | D03RZV | 0.246 |