NPs Basic Information
|
Name |
Versicobenzo B
|
| Molecular Formula | C10H10O5 | |
| IUPAC Name* |
5,7-dihydroxy-6-methoxy-4-methyl-3H-2-benzofuran-1-one
|
|
| SMILES |
CC1=C2COC(=O)C2=C(C(=C1O)OC)O
|
|
| InChI |
InChI=1S/C10H10O5/c1-4-5-3-15-10(13)6(5)8(12)9(14-2)7(4)11/h11-12H,3H2,1-2H3
|
|
| InChIKey |
IQSQGZXOMFBDKJ-UHFFFAOYSA-N
|
|
| Synonyms |
Versicobenzo B
|
|
| CAS | NA | |
| PubChem CID | 156582406 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 210.18 | ALogp: | 1.5 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.687 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.045 | MDCK Permeability: | 0.00000963 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.01 |
| Human Intestinal Absorption (HIA): | 0.034 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.002 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 96.44% |
| Volume Distribution (VD): | 0.465 | Fu: | 9.74% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.677 | CYP1A2-substrate: | 0.91 |
| CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.076 |
| CYP2C9-inhibitor: | 0.23 | CYP2C9-substrate: | 0.455 |
| CYP2D6-inhibitor: | 0.097 | CYP2D6-substrate: | 0.231 |
| CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.088 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 14.477 | Half-life (T1/2): | 0.889 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.115 |
| Drug-inuced Liver Injury (DILI): | 0.323 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.643 | Maximum Recommended Daily Dose: | 0.053 |
| Skin Sensitization: | 0.895 | Carcinogencity: | 0.68 |
| Eye Corrosion: | 0.253 | Eye Irritation: | 0.918 |
| Respiratory Toxicity: | 0.256 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
 |
D04FBR |  |
0.351 | ||||
|
D06GCK |  |
0.253 | ||||
|
D07MGA |  |
0.247 | ||||
|
D0G4KG |  |
0.240 | ||||
|
D0WY9N |  |
0.231 | ||||
|
D04UTT |  |
0.216 | ||||
|
D0L1JW |  |
0.212 | ||||
|
D08SKH |  |
0.211 | ||||
|
D07MEH |  |
0.205 | ||||
|
D04TDQ |  |
0.202 | ||||