|
Name |
(4S)-3-Oxo-4-benzyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde
|
Molecular Formula | C15H13NO3 | |
IUPAC Name* |
(4S)-4-benzyl-3-oxo-1,4-dihydropyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde
|
|
SMILES |
C1C2=CC=C(N2[C@H](C(=O)O1)CC3=CC=CC=C3)C=O
|
|
InChI |
InChI=1S/C15H13NO3/c17-9-12-6-7-13-10-19-15(18)14(16(12)13)8-11-4-2-1-3-5-11/h1-7,9,14H,8,10H2/t14-/m0/s1
|
|
InChIKey |
UMCJKAAHDXLKRZ-AWEZNQCLSA-N
|
|
Synonyms |
(4S)-3-Oxo-4-benzyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde; (S)-4-benzyl-3-oxo-3,4-dihydro-1H-pyrrolo[2,1-c] [1,4]oxazine-6-carbaldehyde
|
|
CAS | NA | |
PubChem CID | 122389043 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 255.27 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 48.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.626 |
Caco-2 Permeability: | -4.661 | MDCK Permeability: | 0.00003120 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.673 | Plasma Protein Binding (PPB): | 65.33% |
Volume Distribution (VD): | 1.188 | Fu: | 35.77% |
CYP1A2-inhibitor: | 0.914 | CYP1A2-substrate: | 0.085 |
CYP2C19-inhibitor: | 0.948 | CYP2C19-substrate: | 0.158 |
CYP2C9-inhibitor: | 0.764 | CYP2C9-substrate: | 0.547 |
CYP2D6-inhibitor: | 0.062 | CYP2D6-substrate: | 0.356 |
CYP3A4-inhibitor: | 0.197 | CYP3A4-substrate: | 0.615 |
Clearance (CL): | 12.027 | Half-life (T1/2): | 0.673 |
hERG Blockers: | 0.072 | Human Hepatotoxicity (H-HT): | 0.167 |
Drug-inuced Liver Injury (DILI): | 0.922 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.025 | Maximum Recommended Daily Dose: | 0.677 |
Skin Sensitization: | 0.14 | Carcinogencity: | 0.348 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.221 |
Respiratory Toxicity: | 0.15 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003437 | 0.523 | D0H6TP | 0.320 | ||||
ENC002563 | 0.420 | D02WCI | 0.319 | ||||
ENC001970 | 0.408 | D08FTG | 0.316 | ||||
ENC004822 | 0.408 | D05VLS | 0.315 | ||||
ENC004861 | 0.397 | D0B1FE | 0.308 | ||||
ENC002940 | 0.393 | D0G1VX | 0.308 | ||||
ENC003272 | 0.393 | D06BYV | 0.306 | ||||
ENC003593 | 0.382 | D0I0DL | 0.305 | ||||
ENC001910 | 0.380 | D05OIS | 0.300 | ||||
ENC004648 | 0.378 | D0QL3P | 0.298 |