|
Name |
Pinazaphilone A
|
Molecular Formula | C21H20O9 | |
IUPAC Name* |
(E)-3-[(6R,7S)-7-(2,4-dihydroxy-6-methylbenzoyl)oxy-6-hydroxy-7-methyl-8-oxo-5,6-dihydro-1H-isochromen-3-yl]prop-2-enoic acid
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@]2([C@@H](CC3=C(C2=O)COC(=C3)/C=C/C(=O)O)O)C)O)O
|
|
InChI |
InChI=1S/C21H20O9/c1-10-5-12(22)8-15(23)18(10)20(28)30-21(2)16(24)7-11-6-13(3-4-17(25)26)29-9-14(11)19(21)27/h3-6,8,16,22-24H,7,9H2,1-2H3,(H,25,26)/b4-3+/t16-,21+/m1/s1
|
|
InChIKey |
QPTACLRMSGFDEE-DMDWLKPBSA-N
|
|
Synonyms |
Pinazaphilone A; CHEMBL3593564; Pinophilin F; BDBM50104726; J3.501.542F
|
|
CAS | NA | |
PubChem CID | 122182011 | |
ChEMBL ID | CHEMBL3593564 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 416.4 | ALogp: | 1.6 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 151.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.427 |
Caco-2 Permeability: | -5.644 | MDCK Permeability: | 0.00001060 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.862 |
Human Intestinal Absorption (HIA): | 0.383 | 20% Bioavailability (F20%): | 0.978 |
30% Bioavailability (F30%): | 0.987 |
Blood-Brain-Barrier Penetration (BBB): | 0.095 | Plasma Protein Binding (PPB): | 80.75% |
Volume Distribution (VD): | 0.414 | Fu: | 9.68% |
CYP1A2-inhibitor: | 0.642 | CYP1A2-substrate: | 0.145 |
CYP2C19-inhibitor: | 0.07 | CYP2C19-substrate: | 0.046 |
CYP2C9-inhibitor: | 0.503 | CYP2C9-substrate: | 0.599 |
CYP2D6-inhibitor: | 0.441 | CYP2D6-substrate: | 0.123 |
CYP3A4-inhibitor: | 0.324 | CYP3A4-substrate: | 0.128 |
Clearance (CL): | 5.241 | Half-life (T1/2): | 0.865 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.85 |
Drug-inuced Liver Injury (DILI): | 0.976 | AMES Toxicity: | 0.185 |
Rat Oral Acute Toxicity: | 0.24 | Maximum Recommended Daily Dose: | 0.949 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.628 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.153 |
Respiratory Toxicity: | 0.319 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002131 | 0.818 | D07MGA | 0.268 | ||||
ENC003837 | 0.780 | D0V9EN | 0.261 | ||||
ENC002726 | 0.635 | D0KN2M | 0.255 | ||||
ENC002211 | 0.633 | D08NQZ | 0.231 | ||||
ENC002132 | 0.615 | D04AIT | 0.230 | ||||
ENC003640 | 0.573 | D0J2NK | 0.228 | ||||
ENC003615 | 0.571 | D08LTU | 0.226 | ||||
ENC002725 | 0.569 | D0K8KX | 0.226 | ||||
ENC003448 | 0.509 | D0R9WP | 0.222 | ||||
ENC002798 | 0.477 | D0H1AR | 0.222 |