|
Name |
Comazaphilone A
|
Molecular Formula | C22H26O7 | |
IUPAC Name* |
[(6R,7R)-6-hydroxy-7-methyl-8-oxo-3-propyl-5,6-dihydro-1H-isochromen-7-yl] 4-hydroxy-2-methoxy-6-methylbenzoate
|
|
SMILES |
CCCC1=CC2=C(CO1)C(=O)[C@]([C@@H](C2)O)(C)OC(=O)C3=C(C=C(C=C3C)O)OC
|
|
InChI |
InChI=1S/C22H26O7/c1-5-6-15-8-13-9-18(24)22(3,20(25)16(13)11-28-15)29-21(26)19-12(2)7-14(23)10-17(19)27-4/h7-8,10,18,23-24H,5-6,9,11H2,1-4H3/t18-,22-/m1/s1
|
|
InChIKey |
BJMHMPAXPWFBRJ-XMSQKQJNSA-N
|
|
Synonyms |
Comazaphilone A; CHEBI:70010; CHEMBL1689195; Q27138351; (6R,7R)-6-Hydroxy-7-methyl-8-oxo-3-propyl-5,6,7,8-tetrahydro-1H-isochromen-7-yl 4-hydroxy-2-methoxy-6-methylbenzoate; [(6R,7R)-6-hydroxy-7-methyl-8-oxo-3-propyl-5,6-dihydro-1H-isochromen-7-yl] 4-hydroxy-2-methoxy-6-methyl-benzoate; rel-(6R,7R)-6-hydroxy-7-methyl-8-oxo-3-propyl-5,6,7,8-tetrahydro-1H-isochromen-7-yl 4-hydroxy-2-methoxy-6-methylbenzoate
|
|
CAS | NA | |
PubChem CID | 51041529 | |
ChEMBL ID | CHEMBL1689195 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.4 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.723 |
Caco-2 Permeability: | -4.949 | MDCK Permeability: | 0.00002290 |
Pgp-inhibitor: | 0.089 | Pgp-substrate: | 0.627 |
Human Intestinal Absorption (HIA): | 0.156 | 20% Bioavailability (F20%): | 0.955 |
30% Bioavailability (F30%): | 0.517 |
Blood-Brain-Barrier Penetration (BBB): | 0.937 | Plasma Protein Binding (PPB): | 89.77% |
Volume Distribution (VD): | 0.773 | Fu: | 6.62% |
CYP1A2-inhibitor: | 0.791 | CYP1A2-substrate: | 0.445 |
CYP2C19-inhibitor: | 0.483 | CYP2C19-substrate: | 0.753 |
CYP2C9-inhibitor: | 0.656 | CYP2C9-substrate: | 0.501 |
CYP2D6-inhibitor: | 0.484 | CYP2D6-substrate: | 0.217 |
CYP3A4-inhibitor: | 0.909 | CYP3A4-substrate: | 0.596 |
Clearance (CL): | 7.98 | Half-life (T1/2): | 0.711 |
hERG Blockers: | 0.351 | Human Hepatotoxicity (H-HT): | 0.771 |
Drug-inuced Liver Injury (DILI): | 0.448 | AMES Toxicity: | 0.028 |
Rat Oral Acute Toxicity: | 0.945 | Maximum Recommended Daily Dose: | 0.946 |
Skin Sensitization: | 0.517 | Carcinogencity: | 0.304 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.048 |
Respiratory Toxicity: | 0.794 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002131 | 0.596 | D0C1SF | 0.274 | ||||
ENC003304 | 0.569 | D07MGA | 0.273 | ||||
ENC003448 | 0.477 | D04UTT | 0.246 | ||||
ENC002726 | 0.462 | D0P1FO | 0.243 | ||||
ENC003615 | 0.462 | D09DHY | 0.242 | ||||
ENC002211 | 0.450 | D0F7CS | 0.238 | ||||
ENC002132 | 0.443 | D0WY9N | 0.237 | ||||
ENC003837 | 0.429 | D06FVX | 0.236 | ||||
ENC002461 | 0.366 | D06GCK | 0.233 | ||||
ENC002576 | 0.362 | D0D4HN | 0.233 |