|
Name |
(3R,4R,5S,6R)-4-hydroxy-3,5-dimethyl-6-[(E,3S)-3-methylpent-1-enyl]oxan-2-one
|
Molecular Formula | C13H22O3 | |
IUPAC Name* |
(3R,4R,5S,6R)-4-hydroxy-3,5-dimethyl-6-[(E,3S)-3-methylpent-1-enyl]oxan-2-one
|
|
SMILES |
CC[C@H](C)/C=C/[C@@H]1[C@H]([C@H]([C@H](C(=O)O1)C)O)C
|
|
InChI |
InChI=1S/C13H22O3/c1-5-8(2)6-7-11-9(3)12(14)10(4)13(15)16-11/h6-12,14H,5H2,1-4H3/b7-6+/t8-,9+,10+,11+,12+/m0/s1
|
|
InChIKey |
ILDJSXPOMKNCOL-YIEQHGPISA-N
|
|
Synonyms |
LMA-P2
|
|
CAS | NA | |
PubChem CID | 101542392 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 226.31 | ALogp: | 2.8 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.594 |
Caco-2 Permeability: | -4.616 | MDCK Permeability: | 0.00003310 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.019 |
Human Intestinal Absorption (HIA): | 0.643 | 20% Bioavailability (F20%): | 0.03 |
30% Bioavailability (F30%): | 0.612 |
Blood-Brain-Barrier Penetration (BBB): | 0.826 | Plasma Protein Binding (PPB): | 83.69% |
Volume Distribution (VD): | 1.041 | Fu: | 6.06% |
CYP1A2-inhibitor: | 0.268 | CYP1A2-substrate: | 0.315 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.852 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.325 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.231 |
CYP3A4-inhibitor: | 0.124 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 4.87 | Half-life (T1/2): | 0.317 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.724 |
Drug-inuced Liver Injury (DILI): | 0.648 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.465 | Maximum Recommended Daily Dose: | 0.546 |
Skin Sensitization: | 0.105 | Carcinogencity: | 0.062 |
Eye Corrosion: | 0.02 | Eye Irritation: | 0.045 |
Respiratory Toxicity: | 0.585 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002880 | 0.489 | D06WTZ | 0.220 | ||||
ENC004741 | 0.333 | D0S3WH | 0.210 | ||||
ENC004878 | 0.323 | D0K7LU | 0.197 | ||||
ENC002004 | 0.314 | D0V0IX | 0.191 | ||||
ENC002532 | 0.295 | D0ZI4H | 0.186 | ||||
ENC005231 | 0.286 | D0N3NO | 0.184 | ||||
ENC004902 | 0.284 | D04CSZ | 0.183 | ||||
ENC004876 | 0.281 | D0H0ND | 0.181 | ||||
ENC004875 | 0.281 | D0R2KF | 0.177 | ||||
ENC004874 | 0.281 | D03KXY | 0.176 |