|
Name |
epi-Longipinanol
|
Molecular Formula | C15H26O | |
IUPAC Name* |
(2S,6S,7S)-2,6,9,9-tetramethyltricyclo[5.4.0.03,8]undecan-6-ol
|
|
SMILES |
C[C@@H]1C2CCC(C3[C@H]2[C@@](CCC13)(C)O)(C)C
|
|
InChI |
InChI=1S/C15H26O/c1-9-10-6-8-15(4,16)13-11(9)5-7-14(2,3)12(10)13/h9-13,16H,5-8H2,1-4H3/t9-,10?,11?,12?,13-,15-/m0/s1
|
|
InChIKey |
WHIUDXGNUHDGLA-AYMWDHPDSA-N
|
|
Synonyms |
epi-Longipinanol; Q67879863
|
|
CAS | NA | |
PubChem CID | 91746617 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.37 | ALogp: | 3.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 16 | QED Weighted: | 0.651 |
Caco-2 Permeability: | -4.593 | MDCK Permeability: | 0.00003390 |
Pgp-inhibitor: | 0.038 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.055 |
30% Bioavailability (F30%): | 0.052 |
Blood-Brain-Barrier Penetration (BBB): | 0.591 | Plasma Protein Binding (PPB): | 89.13% |
Volume Distribution (VD): | 1.185 | Fu: | 11.67% |
CYP1A2-inhibitor: | 0.29 | CYP1A2-substrate: | 0.512 |
CYP2C19-inhibitor: | 0.124 | CYP2C19-substrate: | 0.92 |
CYP2C9-inhibitor: | 0.269 | CYP2C9-substrate: | 0.242 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.286 |
CYP3A4-inhibitor: | 0.194 | CYP3A4-substrate: | 0.43 |
Clearance (CL): | 15.765 | Half-life (T1/2): | 0.075 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.284 |
Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.777 | Maximum Recommended Daily Dose: | 0.234 |
Skin Sensitization: | 0.101 | Carcinogencity: | 0.13 |
Eye Corrosion: | 0.517 | Eye Irritation: | 0.223 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002222 | 0.458 | D0U3GL | 0.284 | ||||
ENC002256 | 0.433 | D04SFH | 0.276 | ||||
ENC003089 | 0.413 | D0I2SD | 0.276 | ||||
ENC001893 | 0.387 | D0SC8F | 0.272 | ||||
ENC001196 | 0.381 | D07QKN | 0.271 | ||||
ENC001299 | 0.381 | D0V8HA | 0.271 | ||||
ENC003118 | 0.377 | D0N6FH | 0.269 | ||||
ENC002221 | 0.365 | D0Z1XD | 0.268 | ||||
ENC003125 | 0.365 | D0Q6NZ | 0.267 | ||||
ENC002827 | 0.364 | D08QKJ | 0.261 |