|
Name |
Methyl 11-(3-pentyl-2-oxiranyl)undecanoate, cis-
|
Molecular Formula | C19H36O3 | |
IUPAC Name* |
methyl 11-[(2R,3S)-3-pentyloxiran-2-yl]undecanoate
|
|
SMILES |
CCCCC[C@H]1[C@H](O1)CCCCCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C19H36O3/c1-3-4-11-14-17-18(22-17)15-12-9-7-5-6-8-10-13-16-19(20)21-2/h17-18H,3-16H2,1-2H3/t17-,18+/m0/s1
|
|
InChIKey |
CJIHQKTUUVMNSU-ZWKOTPCHSA-N
|
|
Synonyms |
Methyl 11-(3-pentyl-2-oxiranyl)undecanoate, cis-; Oxiraneundecanoic acid, 3-pentyl-, methyl ester, cis-; 3alpha-Pentyl-2alpha-oxiraneundecanoic acid methyl ester
|
|
CAS | NA | |
PubChem CID | 91692407 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 312.5 | ALogp: | 6.5 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 38.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 22 | QED Weighted: | 0.223 |
Caco-2 Permeability: | -4.766 | MDCK Permeability: | 0.00001960 |
Pgp-inhibitor: | 0.646 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.154 | Plasma Protein Binding (PPB): | 97.04% |
Volume Distribution (VD): | 1.249 | Fu: | 1.98% |
CYP1A2-inhibitor: | 0.299 | CYP1A2-substrate: | 0.471 |
CYP2C19-inhibitor: | 0.386 | CYP2C19-substrate: | 0.246 |
CYP2C9-inhibitor: | 0.246 | CYP2C9-substrate: | 0.86 |
CYP2D6-inhibitor: | 0.121 | CYP2D6-substrate: | 0.082 |
CYP3A4-inhibitor: | 0.455 | CYP3A4-substrate: | 0.091 |
Clearance (CL): | 5.364 | Half-life (T1/2): | 0.232 |
hERG Blockers: | 0.349 | Human Hepatotoxicity (H-HT): | 0.153 |
Drug-inuced Liver Injury (DILI): | 0.64 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.122 |
Eye Corrosion: | 0.721 | Eye Irritation: | 0.903 |
Respiratory Toxicity: | 0.944 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001227 | 0.750 | D07ILQ | 0.482 | ||||
ENC000604 | 0.708 | D0O1PH | 0.449 | ||||
ENC000560 | 0.701 | D0Z5SM | 0.444 | ||||
ENC000271 | 0.696 | D0XN8C | 0.435 | ||||
ENC000495 | 0.688 | D05ATI | 0.429 | ||||
ENC000260 | 0.667 | D0T9TJ | 0.400 | ||||
ENC000496 | 0.667 | D09ANG | 0.384 | ||||
ENC001540 | 0.640 | D00FGR | 0.380 | ||||
ENC000280 | 0.640 | D00MLW | 0.374 | ||||
ENC001680 | 0.640 | D00AOJ | 0.368 |