|
Name |
Methyl vaccenate
|
Molecular Formula | C19H36O2 | |
IUPAC Name* |
methyl (E)-octadec-11-enoate
|
|
SMILES |
CCCCCC/C=C/CCCCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h8-9H,3-7,10-18H2,1-2H3/b9-8+
|
|
InChIKey |
PVVODBCDJBGMJL-CMDGGOBGSA-N
|
|
Synonyms |
Methyl vaccenate; 6198-58-9; trans-11-Octadecenoic acid methyl ester; Methyl (E)-octadec-11-enoate; Methyl trans-11-octadecenoate; Methyl trans-vaccenate; METHYL 11-OCTADECENOATE; TRANS-11-OCTADECENOICACIDMETHYLESTER; 11-Octadecenoic acid, methyl ester; methyl (11E)-octadec-11-enoate; 6O9MGA9PP2; 52380-33-3; delta 11 trans Octadecenoic acid methyl ester; methyl octadec-11-enoate; UNII-6O9MGA9PP2; 11-octadecenoic acid methyl ester; EINECS 217-714-5; EINECS 228-251-3; Methyl transvaccenate; MFCD00064484; trans-VACCENIC ACID METHYL ESTER; trans-Methyl vaccenate; SCHEMBL123510; SCHEMBL123511; (E)-methyl octadec-11-enoate; (E)-Vaccenic acid methyl ester; trans-Vaccenic acid, methyl ester; DTXSID301316726; VACCENIC ACID, METHYL ESTER; Methyl (11E)-11-octadecenoate #; Octadec-11-enoic acid, methyl ester; STL451001; AKOS037645762; ZINC100173966; VACCENIC ACID METHYL ESTER [MI]; AS-63233; M2309; 11-OCTADECENOIC ACID, METHYL ESTER, (E)-; Q27265228; TRANS-.DELTA.11-OCTADECENIC ACID METHYL ESTER; Methyl trans-vaccenate, >=99% (capillary GC), liquid; trans-11-Octadecenoic acid-methyl ester 10 microg/mL in Cyclohexane
|
|
CAS | 6198-58-9 | |
PubChem CID | 5364432 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.5 | ALogp: | 7.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.204 |
Caco-2 Permeability: | -4.778 | MDCK Permeability: | 0.00002330 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.921 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.429 | Plasma Protein Binding (PPB): | 99.22% |
Volume Distribution (VD): | 3.858 | Fu: | 1.02% |
CYP1A2-inhibitor: | 0.554 | CYP1A2-substrate: | 0.203 |
CYP2C19-inhibitor: | 0.453 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.273 | CYP2C9-substrate: | 0.966 |
CYP2D6-inhibitor: | 0.491 | CYP2D6-substrate: | 0.141 |
CYP3A4-inhibitor: | 0.55 | CYP3A4-substrate: | 0.06 |
Clearance (CL): | 3.469 | Half-life (T1/2): | 0.485 |
hERG Blockers: | 0.248 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.049 |
Eye Corrosion: | 0.923 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.838 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001688 | 1.000 | D0O1PH | 0.703 | ||||
ENC001687 | 0.935 | D0O1TC | 0.519 | ||||
ENC001627 | 0.909 | D07ILQ | 0.500 | ||||
ENC001435 | 0.900 | D0OR6A | 0.469 | ||||
ENC001714 | 0.853 | D0Z5SM | 0.462 | ||||
ENC001645 | 0.850 | D05ATI | 0.446 | ||||
ENC001670 | 0.836 | D0UE9X | 0.444 | ||||
ENC001678 | 0.833 | D00FGR | 0.392 | ||||
ENC001699 | 0.800 | D0H2YX | 0.388 | ||||
ENC001555 | 0.800 | D00MLW | 0.385 |