|
Name |
5-Hydroxy-8-methoxy-2,4-dimethylnaphtho[1,2-b]furan-6,9-dione
|
Molecular Formula | C15H12O5 | |
IUPAC Name* |
5-hydroxy-8-methoxy-2,4-dimethylbenzo[g][1]benzofuran-6,9-dione
|
|
SMILES |
CC1=CC2=C(C(=C3C(=O)C=C(C(=O)C3=C2O1)OC)O)C
|
|
InChI |
InChI=1S/C15H12O5/c1-6-4-8-7(2)13(17)11-9(16)5-10(19-3)14(18)12(11)15(8)20-6/h4-5,17H,1-3H3
|
|
InChIKey |
VPFPRRFNKURUNF-UHFFFAOYSA-N
|
|
Synonyms |
Anhydrojavanicin; 5-hydroxy-8-methoxy-2,4-dimethylnaphtho[1,2-b]furan-6,9-dione; 5-hydroxy-8-methoxy-2,4-dimethyl-benzo[g]benzofuran-6,9-dione
|
|
CAS | NA | |
PubChem CID | 86184216 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 272.25 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.86 |
Caco-2 Permeability: | -4.892 | MDCK Permeability: | 0.00002170 |
Pgp-inhibitor: | 0.033 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.539 |
Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 92.28% |
Volume Distribution (VD): | 0.337 | Fu: | 4.91% |
CYP1A2-inhibitor: | 0.97 | CYP1A2-substrate: | 0.935 |
CYP2C19-inhibitor: | 0.632 | CYP2C19-substrate: | 0.455 |
CYP2C9-inhibitor: | 0.754 | CYP2C9-substrate: | 0.692 |
CYP2D6-inhibitor: | 0.639 | CYP2D6-substrate: | 0.304 |
CYP3A4-inhibitor: | 0.664 | CYP3A4-substrate: | 0.198 |
Clearance (CL): | 9.637 | Half-life (T1/2): | 0.242 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.904 |
Drug-inuced Liver Injury (DILI): | 0.935 | AMES Toxicity: | 0.81 |
Rat Oral Acute Toxicity: | 0.934 | Maximum Recommended Daily Dose: | 0.905 |
Skin Sensitization: | 0.569 | Carcinogencity: | 0.925 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.335 |
Respiratory Toxicity: | 0.633 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002282 | 0.565 | D0FA2O | 0.347 | ||||
ENC002455 | 0.543 | D0G4KG | 0.338 | ||||
ENC006088 | 0.535 | D0O6KE | 0.276 | ||||
ENC000334 | 0.535 | D06GCK | 0.268 | ||||
ENC005342 | 0.535 | D0C1SF | 0.253 | ||||
ENC005157 | 0.521 | D06XZW | 0.239 | ||||
ENC000925 | 0.521 | D01XWG | 0.227 | ||||
ENC005166 | 0.514 | D07MGA | 0.223 | ||||
ENC002706 | 0.479 | D0JO3U | 0.222 | ||||
ENC005529 | 0.466 | D0N1FS | 0.221 |