|
Name |
Javanicin
|
Molecular Formula | C15H14O6 | |
IUPAC Name* |
5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione
|
|
SMILES |
CC1=C(C(=C2C(=C1O)C(=O)C=C(C2=O)OC)O)CC(=O)C
|
|
InChI |
InChI=1S/C15H14O6/c1-6(16)4-8-7(2)13(18)11-9(17)5-10(21-3)15(20)12(11)14(8)19/h5,18-19H,4H2,1-3H3
|
|
InChIKey |
UHPMCKVQTMMPCG-UHFFFAOYSA-N
|
|
Synonyms |
JAVANICIN; 476-45-9; 5,8-Dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione; YNR51WFW2R; 3-Acetonyl-5,8-dihydroxy-6-methoxy-2-methyl-1,4-naphthoquinone; 5,8-dihydroxy-6-methoxy-2-methyl-3-(2-oxopropyl)naphthalene-1,4-dione; Javanicin (Fusarium); HSDB 3501; UNII-YNR51WFW2R; BRN 2296055; fusarium; 1,4-Naphthalenedione, 5,8-dihydroxy-6-methoxy-2-methyl-3-(2-oxopropyl)-; 5,8-Dihydroxy-6-methoxy-3-(2-oxopropyl)-1,4-naphthalenedione; JAVANICIN [MI]; JAVANICIN [HSDB]; 1,4-Naphthoquinone, 3-acetonyl-5,8-dihydroxy-6-methoxy-2-methyl-; 4-08-00-03646 (Beilstein Handbook Reference); SCHEMBL3147213; CHEMBL1224810; DTXSID30871664; DTXSID40963882; 5,8-Dihydroxy-6-methoxy-2-methyl-3-(2-oxopropyl)-1,4-naphthalenedione; Q27294612; 7-acetonyl-5,8-dihydroxy-2-methoxy-6-methyl-naphthalene-1,4-dione; 1,4-NAPHTHALENEDIONE, 7-ACETONYL-5,8-DIHYDROXY-2-METHOXY-6-METHYL-; 1,4-NAPHTHALENEDIONE, 5,8-DIHYDROXY-2-METHOXY-6-METHYL-7-(2-OXOPROPYL)-; 1834-07-7
|
|
CAS | 476-45-9 | |
PubChem CID | 10149 | |
ChEMBL ID | CHEMBL1224810 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.27 | ALogp: | 2.0 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 101.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.825 |
Caco-2 Permeability: | -5.207 | MDCK Permeability: | 0.00000428 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.104 | 20% Bioavailability (F20%): | 0.051 |
30% Bioavailability (F30%): | 0.755 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 93.14% |
Volume Distribution (VD): | 0.686 | Fu: | 13.44% |
CYP1A2-inhibitor: | 0.928 | CYP1A2-substrate: | 0.854 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.204 | CYP2C9-substrate: | 0.63 |
CYP2D6-inhibitor: | 0.269 | CYP2D6-substrate: | 0.179 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.09 |
Clearance (CL): | 4.241 | Half-life (T1/2): | 0.933 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.043 |
Drug-inuced Liver Injury (DILI): | 0.793 | AMES Toxicity: | 0.692 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.477 |
Skin Sensitization: | 0.915 | Carcinogencity: | 0.437 |
Eye Corrosion: | 0.042 | Eye Irritation: | 0.888 |
Respiratory Toxicity: | 0.496 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006088 | 1.000 | D0WY9N | 0.277 | ||||
ENC005342 | 0.719 | D01XWG | 0.274 | ||||
ENC005529 | 0.662 | D07VLY | 0.258 | ||||
ENC003030 | 0.535 | D0C9XJ | 0.258 | ||||
ENC002282 | 0.535 | D01XDL | 0.254 | ||||
ENC005157 | 0.534 | D04FBR | 0.246 | ||||
ENC000925 | 0.534 | D0N1FS | 0.243 | ||||
ENC005119 | 0.514 | D0O6KE | 0.235 | ||||
ENC000709 | 0.500 | D0T5XN | 0.230 | ||||
ENC002308 | 0.500 | D06GCK | 0.228 |