|
Name |
Cochlioquinone E
|
Molecular Formula | C28H40O7 | |
IUPAC Name* |
(1S,3R,4aR,6aR,12aR,12bS)-1-hydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-9-[(2S,4S)-4-methyl-3-oxohexan-2-yl]-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthene-8,11-dione
|
|
SMILES |
CC[C@H](C)C(=O)[C@@H](C)C1=CC(=O)C2=C(C1=O)O[C@@]3(CC[C@@H]4[C@@]([C@H]3C2)([C@H](C[C@@H](O4)C(C)(C)O)O)C)C
|
|
InChI |
InChI=1S/C28H40O7/c1-8-14(2)23(31)15(3)16-11-18(29)17-12-19-27(6,35-25(17)24(16)32)10-9-21-28(19,7)20(30)13-22(34-21)26(4,5)33/h11,14-15,19-22,30,33H,8-10,12-13H2,1-7H3/t14-,15-,19-,20-,21+,22+,27+,28-/m0/s1
|
|
InChIKey |
HXPBRLMQASJJQR-YRDJGWMFSA-N
|
|
Synonyms |
COCHLIOQUINONE E; CHEMBL2288172
|
|
CAS | NA | |
PubChem CID | 76312972 | |
ChEMBL ID | CHEMBL2288172 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 488.6 | ALogp: | 2.9 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 110.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.558 |
Caco-2 Permeability: | -4.78 | MDCK Permeability: | 0.00001580 |
Pgp-inhibitor: | 0.91 | Pgp-substrate: | 0.495 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.245 |
30% Bioavailability (F30%): | 0.023 |
Blood-Brain-Barrier Penetration (BBB): | 0.415 | Plasma Protein Binding (PPB): | 97.90% |
Volume Distribution (VD): | 1.334 | Fu: | 2.18% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.591 |
CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.646 |
CYP2C9-inhibitor: | 0.24 | CYP2C9-substrate: | 0.535 |
CYP2D6-inhibitor: | 0.209 | CYP2D6-substrate: | 0.184 |
CYP3A4-inhibitor: | 0.399 | CYP3A4-substrate: | 0.681 |
Clearance (CL): | 8.973 | Half-life (T1/2): | 0.583 |
hERG Blockers: | 0.272 | Human Hepatotoxicity (H-HT): | 0.496 |
Drug-inuced Liver Injury (DILI): | 0.024 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.26 | Maximum Recommended Daily Dose: | 0.959 |
Skin Sensitization: | 0.703 | Carcinogencity: | 0.024 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.033 |
Respiratory Toxicity: | 0.938 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002924 | 0.788 | D0W2EK | 0.272 | ||||
ENC003638 | 0.786 | D02IQY | 0.247 | ||||
ENC002674 | 0.691 | D06IIB | 0.246 | ||||
ENC003011 | 0.614 | D04QNO | 0.243 | ||||
ENC005797 | 0.600 | D0Y7IU | 0.243 | ||||
ENC002182 | 0.561 | D0F7NQ | 0.242 | ||||
ENC004572 | 0.561 | D02JNM | 0.241 | ||||
ENC000943 | 0.540 | D0P0HT | 0.241 | ||||
ENC003006 | 0.500 | D0I5DS | 0.239 | ||||
ENC004573 | 0.496 | D0D2TN | 0.239 |