|
Name |
Isocochlioquinone C
|
Molecular Formula | C28H40O7 | |
IUPAC Name* |
(3R,4aR,6aR,12aR,12bR)-8,11-dihydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-9-[(2S,4S)-4-methyl-3-oxohexan-2-yl]-2,3,4a,5,6,12a-hexahydro-1H-pyrano[3,2-a]xanthen-12-one
|
|
SMILES |
CC[C@H](C)C(=O)[C@@H](C)C1=CC(=C2C(=O)[C@@H]3[C@]4(CC[C@@H](O[C@@H]4CC[C@]3(OC2=C1O)C)C(C)(C)O)C)O
|
|
InChI |
InChI=1S/C28H40O7/c1-8-14(2)21(30)15(3)16-13-17(29)20-23(32)25-27(6)11-9-18(26(4,5)33)34-19(27)10-12-28(25,7)35-24(20)22(16)31/h13-15,18-19,25,29,31,33H,8-12H2,1-7H3/t14-,15-,18+,19+,25+,27-,28+/m0/s1
|
|
InChIKey |
NZUVNIFDHVYNAE-AXSAHRJFSA-N
|
|
Synonyms |
ISOCOCHLIOQUINONE C; CHEMBL2288174
|
|
CAS | NA | |
PubChem CID | 76309270 | |
ChEMBL ID | CHEMBL2288174 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 488.6 | ALogp: | 4.6 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.484 |
Caco-2 Permeability: | -4.698 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.393 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.285 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.376 | Plasma Protein Binding (PPB): | 99.10% |
Volume Distribution (VD): | 0.863 | Fu: | 1.40% |
CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.869 |
CYP2C19-inhibitor: | 0.058 | CYP2C19-substrate: | 0.635 |
CYP2C9-inhibitor: | 0.361 | CYP2C9-substrate: | 0.602 |
CYP2D6-inhibitor: | 0.088 | CYP2D6-substrate: | 0.156 |
CYP3A4-inhibitor: | 0.617 | CYP3A4-substrate: | 0.551 |
Clearance (CL): | 2.337 | Half-life (T1/2): | 0.185 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.834 |
Drug-inuced Liver Injury (DILI): | 0.896 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.975 | Maximum Recommended Daily Dose: | 0.914 |
Skin Sensitization: | 0.545 | Carcinogencity: | 0.019 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.21 |
Respiratory Toxicity: | 0.594 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005795 | 0.788 | D0L7AS | 0.246 | ||||
ENC004251 | 0.780 | D01CKY | 0.246 | ||||
ENC005794 | 0.597 | D0W5LS | 0.241 | ||||
ENC002674 | 0.590 | D0Y7LD | 0.231 | ||||
ENC003638 | 0.586 | D0G4OD | 0.230 | ||||
ENC005797 | 0.521 | D08IWD | 0.228 | ||||
ENC003007 | 0.500 | D04ATM | 0.227 | ||||
ENC000943 | 0.481 | D0WY9N | 0.223 | ||||
ENC004570 | 0.474 | D0W2EK | 0.222 | ||||
ENC005796 | 0.472 | D0H2JP | 0.222 |