|
Name |
Dehydro Lovastatin
|
Molecular Formula | C24H34O4 | |
IUPAC Name* |
[(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R)-6-oxo-2,3-dihydropyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate
|
|
SMILES |
CC[C@H](C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3CC=CC(=O)O3)C
|
|
InChI |
InChI=1S/C24H34O4/c1-5-16(3)24(26)28-21-14-15(2)13-18-10-9-17(4)20(23(18)21)12-11-19-7-6-8-22(25)27-19/h6,8-10,13,15-17,19-21,23H,5,7,11-12,14H2,1-4H3/t15-,16-,17-,19-,20-,21-,23-/m0/s1
|
|
InChIKey |
SPIVMHAGTHFLMO-OCAGQIGWSA-N
|
|
Synonyms |
Dehydro Lovastatin; Dehydromonacolin K; 109273-98-5; Anhydrolovastatin; 2BW5MV3UB3; Dehydrolovastatin; [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R)-6-oxo-2,3-dihydropyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate; L 642257; (1S,3R,7S,8S,8aR)-3,7-Dimethyl-8-(2-((2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl)ethyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate; (S)-(1S,3R,7S,8S,8aR)-3,7-Dimethyl-8-(2-((R)-6-oxo-3,6-dihydro-2H-pyran-2-yl)ethyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2-methylbutanoate; Butanoic acid, 2-methyl-, (1S,3R,7S,8S,8aR)-8-(2-((2R)-3,6-dihydro-6-oxo-2H-pyran-2-yl)ethyl)-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl ester, (2S)-; Dehydrolovostatin; (1S,3R,7S,8S,8aR)-3,7-Dimethyl-8-[2-[(2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-naphthalen-1-yl (2S)-2-Methylbutanoate (Dehydrolovastatin); (1S,3R,7S,8S,8aR)-3,7-Dimethyl-8-{2-[(2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl]ethyl}-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate; Dehydrolovastatin [EP]; starbld0027803; UNII-2BW5MV3UB3; Lovastatin impurity C [EP]; CHEMBL3946905; DTXSID40747447; ZINC65739660; DEHYDROLOVASTATIN [EP IMPURITY]; .ALPHA.,.BETA.-DEHYDROLOVASTATIN; LOVASTATIN IMPURITY C [EP IMPURITY]; Dehydrolovastatin 100 microg/mL in Acetonitrile; J-002256
|
|
CAS | 109273-98-5 | |
PubChem CID | 71315317 | |
ChEMBL ID | CHEMBL3946905 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 386.5 | ALogp: | 5.4 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 52.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.578 |
Caco-2 Permeability: | -4.698 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.094 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.071 | Plasma Protein Binding (PPB): | 96.95% |
Volume Distribution (VD): | 1.969 | Fu: | 2.38% |
CYP1A2-inhibitor: | 0.404 | CYP1A2-substrate: | 0.068 |
CYP2C19-inhibitor: | 0.119 | CYP2C19-substrate: | 0.737 |
CYP2C9-inhibitor: | 0.347 | CYP2C9-substrate: | 0.058 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.063 |
CYP3A4-inhibitor: | 0.866 | CYP3A4-substrate: | 0.69 |
Clearance (CL): | 11.459 | Half-life (T1/2): | 0.479 |
hERG Blockers: | 0.632 | Human Hepatotoxicity (H-HT): | 0.972 |
Drug-inuced Liver Injury (DILI): | 0.612 | AMES Toxicity: | 0.108 |
Rat Oral Acute Toxicity: | 0.236 | Maximum Recommended Daily Dose: | 0.966 |
Skin Sensitization: | 0.956 | Carcinogencity: | 0.103 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.026 |
Respiratory Toxicity: | 0.891 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006007 | 0.733 | D06WTZ | 0.717 | ||||
ENC002580 | 0.717 | D0H0ND | 0.553 | ||||
ENC000662 | 0.576 | D02RQU | 0.459 | ||||
ENC006006 | 0.528 | D0D4IH | 0.225 | ||||
ENC001935 | 0.449 | D05AFC | 0.215 | ||||
ENC001102 | 0.414 | D0Y7IU | 0.215 | ||||
ENC002332 | 0.400 | D04QNO | 0.215 | ||||
ENC006008 | 0.321 | D0M6VK | 0.212 | ||||
ENC004384 | 0.297 | D04LHJ | 0.210 | ||||
ENC004385 | 0.297 | D0D2TN | 0.208 |