|
Name |
Monacolin J
|
Molecular Formula | C19H28O4 | |
IUPAC Name* |
(4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one
|
|
SMILES |
C[C@@H]1C[C@@H]([C@@H]2[C@H]([C@H](C=CC2=C1)C)CC[C@@H]3C[C@H](CC(=O)O3)O)O
|
|
InChI |
InChI=1S/C19H28O4/c1-11-7-13-4-3-12(2)16(19(13)17(21)8-11)6-5-15-9-14(20)10-18(22)23-15/h3-4,7,11-12,14-17,19-21H,5-6,8-10H2,1-2H3/t11-,12-,14+,15+,16-,17-,19-/m0/s1
|
|
InChIKey |
ZDFOBOYQVYMVCW-IRUSZSJRSA-N
|
|
Synonyms |
Monacolin J; Lovastatin Diol Lactone; 79952-42-4; Antibiotic MB 530A; P5IQ0SI56N; UNII-P5IQ0SI56N; monakolin j; 6(R)-[2-(8(S)-Hydroxy]-2(S),6(R)-dimethyl-1,2,6,7,8,8a(R)-hexahydro-1(S)-naphthyl]ethyl-4(R)-hydroxy-3,4,5,6-tetrahydro-2H-pyran-2-one; monacolin J lactone; SCHEMBL1820283; CHEBI:79034; DTXSID801031414; (4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one; ZINC14594736; AKOS022183350; ES-2535; HY-104051; CS-0027590; Q15720548; (4R)-4alpha-Hydroxy-6beta-[2-[(1S)-2beta,6alpha-dimethyl-8alpha-hydroxy-1,2,6,7,8,8abeta-hexahydronaphthalene-1beta-yl]ethyl]tetrahydro-2H-pyran-2-one; (4R,6R)-4-hydroxy-6-{2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}tetrahydro-2H-pyran-2-one; 2H-PYRAN-2-ONE, 6-(2-((1S,2S,6R,8S,8AR)-1,2,6,7,8,8A-HEXAHYDRO-8-HYDROXY-2,6-DIMETHYL-1-NAPHTHALENYL)ETHYL)TETRAHYDRO-4-HYDROXY-, (4R,6R)-; 2H-Pyran-2-one, 6-(2-(1,2,6,7,8,8a-hexahydro-8-hydroxy-2,6-dimethyl-1-naphthalenyl)ethyl)tetrahydro-4-hydroxy-; Lovastatin Diol Lactone ((4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-1,2,6,7,8,8a-Hexahydro-8-hydroxy-2,6-dimethyl-1-naphthalenyl]ethyl]tetrahydro-4-hydroxy-2H-pyran-2-one)
|
|
CAS | 79952-42-4 | |
PubChem CID | 9905162 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.4 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.782 |
Caco-2 Permeability: | -4.814 | MDCK Permeability: | 0.00003250 |
Pgp-inhibitor: | 0.974 | Pgp-substrate: | 0.96 |
Human Intestinal Absorption (HIA): | 0.389 | 20% Bioavailability (F20%): | 0.993 |
30% Bioavailability (F30%): | 0.987 |
Blood-Brain-Barrier Penetration (BBB): | 0.37 | Plasma Protein Binding (PPB): | 91.74% |
Volume Distribution (VD): | 1.286 | Fu: | 4.53% |
CYP1A2-inhibitor: | 0.045 | CYP1A2-substrate: | 0.065 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.798 |
CYP2C9-inhibitor: | 0.026 | CYP2C9-substrate: | 0.091 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.067 |
CYP3A4-inhibitor: | 0.659 | CYP3A4-substrate: | 0.605 |
Clearance (CL): | 13.52 | Half-life (T1/2): | 0.773 |
hERG Blockers: | 0.72 | Human Hepatotoxicity (H-HT): | 0.968 |
Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.069 |
Rat Oral Acute Toxicity: | 0.123 | Maximum Recommended Daily Dose: | 0.995 |
Skin Sensitization: | 0.967 | Carcinogencity: | 0.329 |
Eye Corrosion: | 0.012 | Eye Irritation: | 0.255 |
Respiratory Toxicity: | 0.952 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002332 | 0.703 | D06WTZ | 0.674 | ||||
ENC002580 | 0.674 | D0H0ND | 0.659 | ||||
ENC000662 | 0.543 | D02RQU | 0.295 | ||||
ENC006007 | 0.495 | D03IKT | 0.241 | ||||
ENC002912 | 0.449 | D0F1EX | 0.241 | ||||
ENC003241 | 0.350 | D00GOS | 0.230 | ||||
ENC006006 | 0.321 | D04QNO | 0.230 | ||||
ENC005864 | 0.317 | D0Y7IU | 0.230 | ||||
ENC006008 | 0.313 | D08PIQ | 0.223 | ||||
ENC004384 | 0.300 | D0V9DZ | 0.212 |