|
Name |
4-(2-Hydroxy-3-methoxy-5-methylphenoxy)-2-methyl-6-hydroxybenzoic acid methyl ester
|
Molecular Formula | C17H18O6 | |
IUPAC Name* |
methyl 2-hydroxy-4-(2-hydroxy-3-methoxy-5-methylphenoxy)-6-methylbenzoate
|
|
SMILES |
CC1=CC(=C(C(=C1)OC2=CC(=C(C(=C2)C)C(=O)OC)O)O)OC
|
|
InChI |
InChI=1S/C17H18O6/c1-9-5-13(21-3)16(19)14(6-9)23-11-7-10(2)15(12(18)8-11)17(20)22-4/h5-8,18-19H,1-4H3
|
|
InChIKey |
CQSYTQSDCHFACG-UHFFFAOYSA-N
|
|
Synonyms |
methyl 2-hydroxy-4-(2-hydroxy-3-methoxy-5-methylphenoxy)-6-methylbenzoate; methyl 2-hydroxy-4-(2-hydroy-3-methoxy-5-methylphenoxy)-6-methylbenzoate; 4-(2-Hydroxy-3-methoxy-5-methylphenoxy)-2-methyl-6-hydroxybenzoic acid methyl ester
|
|
CAS | NA | |
PubChem CID | 53360932 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 318.32 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 85.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 23 | QED Weighted: | 0.827 |
Caco-2 Permeability: | -4.903 | MDCK Permeability: | 0.00002070 |
Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.026 |
30% Bioavailability (F30%): | 0.019 |
Blood-Brain-Barrier Penetration (BBB): | 0.055 | Plasma Protein Binding (PPB): | 98.42% |
Volume Distribution (VD): | 0.486 | Fu: | 3.53% |
CYP1A2-inhibitor: | 0.948 | CYP1A2-substrate: | 0.938 |
CYP2C19-inhibitor: | 0.801 | CYP2C19-substrate: | 0.377 |
CYP2C9-inhibitor: | 0.71 | CYP2C9-substrate: | 0.8 |
CYP2D6-inhibitor: | 0.65 | CYP2D6-substrate: | 0.861 |
CYP3A4-inhibitor: | 0.515 | CYP3A4-substrate: | 0.406 |
Clearance (CL): | 11.965 | Half-life (T1/2): | 0.857 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.557 | AMES Toxicity: | 0.079 |
Rat Oral Acute Toxicity: | 0.668 | Maximum Recommended Daily Dose: | 0.824 |
Skin Sensitization: | 0.91 | Carcinogencity: | 0.199 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.941 |
Respiratory Toxicity: | 0.712 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002944 | 0.653 | D06GCK | 0.351 | ||||
ENC001522 | 0.571 | D0W7JZ | 0.297 | ||||
ENC002663 | 0.571 | D07MGA | 0.281 | ||||
ENC004806 | 0.554 | D06RGG | 0.273 | ||||
ENC002468 | 0.554 | D03TPR | 0.273 | ||||
ENC005978 | 0.554 | D09DHY | 0.268 | ||||
ENC001490 | 0.554 | D0NJ3V | 0.267 | ||||
ENC005122 | 0.547 | D01XNB | 0.265 | ||||
ENC005979 | 0.536 | D0C6DT | 0.265 | ||||
ENC005170 | 0.534 | D0A8FB | 0.261 |