|
Name |
Pestalotiollide B
|
Molecular Formula | C21H22O7 | |
IUPAC Name* |
2-[(1S,2S)-1,2-dihydroxy-3-methylbut-3-enyl]-6-hydroxy-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one
|
|
SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)[C@@H]([C@H](C(=C)C)O)O)OC)C(=O)OC2
|
|
InChI |
InChI=1S/C21H22O7/c1-10(2)17(23)18(24)13-5-6-15-16(20(13)26-4)21(25)27-9-12-7-11(3)8-14(22)19(12)28-15/h5-8,17-18,22-24H,1,9H2,2-4H3/t17-,18-/m0/s1
|
|
InChIKey |
HHLSDNCZICXJDV-ROUUACIJSA-N
|
|
Synonyms |
Pestalotiollide B
|
|
CAS | NA | |
PubChem CID | 52920650 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 386.4 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 105.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.54 |
Caco-2 Permeability: | -4.964 | MDCK Permeability: | 0.00001630 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.024 |
Human Intestinal Absorption (HIA): | 0.038 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.157 | Plasma Protein Binding (PPB): | 92.57% |
Volume Distribution (VD): | 0.995 | Fu: | 8.30% |
CYP1A2-inhibitor: | 0.71 | CYP1A2-substrate: | 0.788 |
CYP2C19-inhibitor: | 0.215 | CYP2C19-substrate: | 0.453 |
CYP2C9-inhibitor: | 0.175 | CYP2C9-substrate: | 0.555 |
CYP2D6-inhibitor: | 0.478 | CYP2D6-substrate: | 0.277 |
CYP3A4-inhibitor: | 0.155 | CYP3A4-substrate: | 0.334 |
Clearance (CL): | 13.104 | Half-life (T1/2): | 0.488 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.014 |
Drug-inuced Liver Injury (DILI): | 0.278 | AMES Toxicity: | 0.321 |
Rat Oral Acute Toxicity: | 0.867 | Maximum Recommended Daily Dose: | 0.909 |
Skin Sensitization: | 0.225 | Carcinogencity: | 0.784 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.166 |
Respiratory Toxicity: | 0.364 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006148 | 1.000 | D0F7CS | 0.295 | ||||
ENC002739 | 1.000 | D07MGA | 0.292 | ||||
ENC004016 | 0.786 | D0L1JW | 0.289 | ||||
ENC004017 | 0.744 | D04UTT | 0.283 | ||||
ENC000877 | 0.724 | D06GCK | 0.283 | ||||
ENC001921 | 0.724 | D04TDQ | 0.268 | ||||
ENC004018 | 0.705 | D09DHY | 0.258 | ||||
ENC002005 | 0.663 | D0G4KG | 0.252 | ||||
ENC006147 | 0.613 | D0W8WB | 0.252 | ||||
ENC001927 | 0.577 | D06GIP | 0.250 |