NPs Basic Information
|
Name |
Oblongolide P
|
| Molecular Formula | C14H20O3 | |
| IUPAC Name* |
(3aS,5aR,7R,8R,9aS,9bR)-8-hydroxy-7,9b-dimethyl-3,3a,5a,6,7,8,9,9a-octahydrobenzo[g][2]benzofuran-1-one
|
|
| SMILES |
C[C@@H]1C[C@@H]2C=C[C@@H]3COC(=O)[C@@]3([C@H]2C[C@H]1O)C
|
|
| InChI |
InChI=1S/C14H20O3/c1-8-5-9-3-4-10-7-17-13(16)14(10,2)11(9)6-12(8)15/h3-4,8-12,15H,5-7H2,1-2H3/t8-,9+,10-,11+,12-,14+/m1/s1
|
|
| InChIKey |
ABJNPCNYMQEGPD-TYZAEGSRSA-N
|
|
| Synonyms |
Oblongolide P
|
|
| CAS | NA | |
| PubChem CID | 44471971 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 236.31 | ALogp: | 1.9 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
| Heavy Atoms: | 17 | QED Weighted: | 0.519 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.594 | MDCK Permeability: | 0.00004460 |
| Pgp-inhibitor: | 0.244 | Pgp-substrate: | 0.078 |
| Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.857 |
| 30% Bioavailability (F30%): | 0.751 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.93 | Plasma Protein Binding (PPB): | 74.54% |
| Volume Distribution (VD): | 1.09 | Fu: | 25.39% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.468 | CYP1A2-substrate: | 0.304 |
| CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.747 |
| CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.081 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.23 |
| CYP3A4-inhibitor: | 0.665 | CYP3A4-substrate: | 0.343 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 10.285 | Half-life (T1/2): | 0.703 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.066 |
| Drug-inuced Liver Injury (DILI): | 0.209 | AMES Toxicity: | 0.067 |
| Rat Oral Acute Toxicity: | 0.393 | Maximum Recommended Daily Dose: | 0.09 |
| Skin Sensitization: | 0.89 | Carcinogencity: | 0.201 |
| Eye Corrosion: | 0.895 | Eye Irritation: | 0.984 |
| Respiratory Toxicity: | 0.828 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002165 |  |
1.000 | D00GOS |  |
0.245 | ||
| ENC002170 |  |
0.541 | D03IKT |  |
0.245 | ||
| ENC002638 |  |
0.423 | D08PIQ |  |
0.237 | ||
| ENC002438 |  |
0.308 | D0D2TN |  |
0.237 | ||
| ENC000816 |  |
0.296 | D0CZ1Q |  |
0.237 | ||
| ENC002508 |  |
0.294 | D04SFH |  |
0.237 | ||
| ENC003132 |  |
0.289 | D0Z1FX |  |
0.233 | ||
| ENC002215 |  |
0.288 | D0F1EX |  |
0.232 | ||
| ENC005098 |  |
0.288 | D0S3WH |  |
0.226 | ||
| ENC003491 |  |
0.283 | D0V9DZ |  |
0.224 | ||