|
Name |
Conocenol B
|
Molecular Formula | C15H26O3 | |
IUPAC Name* |
(3aS,4R,5S,7S)-7,8-bis(hydroxymethyl)-2,2,4-trimethyl-3,3a,4,5,6,7-hexahydro-1H-azulen-5-ol
|
|
SMILES |
C[C@H]1[C@H](C[C@@H](C(=C2[C@H]1CC(C2)(C)C)CO)CO)O
|
|
InChI |
InChI=1S/C15H26O3/c1-9-11-5-15(2,3)6-12(11)13(8-17)10(7-16)4-14(9)18/h9-11,14,16-18H,4-8H2,1-3H3/t9-,10-,11+,14+/m1/s1
|
|
InChIKey |
GPDUBFUNTPFFDM-PUHVVEEASA-N
|
|
Synonyms |
Conocenol B
|
|
CAS | NA | |
PubChem CID | 23643843 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.36 | ALogp: | 0.8 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.663 |
Caco-2 Permeability: | -4.682 | MDCK Permeability: | 0.00001030 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.927 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 45.38% |
Volume Distribution (VD): | 0.859 | Fu: | 59.56% |
CYP1A2-inhibitor: | 0.03 | CYP1A2-substrate: | 0.087 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.601 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.305 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.143 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.259 |
Clearance (CL): | 9.885 | Half-life (T1/2): | 0.752 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.165 |
Drug-inuced Liver Injury (DILI): | 0.473 | AMES Toxicity: | 0.167 |
Rat Oral Acute Toxicity: | 0.447 | Maximum Recommended Daily Dose: | 0.814 |
Skin Sensitization: | 0.456 | Carcinogencity: | 0.841 |
Eye Corrosion: | 0.094 | Eye Irritation: | 0.45 |
Respiratory Toxicity: | 0.966 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004070 | 0.426 | D08PIQ | 0.260 | ||||
ENC005663 | 0.408 | D0F1EX | 0.255 | ||||
ENC003906 | 0.315 | D03IKT | 0.255 | ||||
ENC003658 | 0.307 | D07DVK | 0.242 | ||||
ENC003599 | 0.307 | D0IT2G | 0.242 | ||||
ENC002145 | 0.297 | D0CW1P | 0.242 | ||||
ENC002058 | 0.292 | D0V9DZ | 0.235 | ||||
ENC004784 | 0.291 | D0CZ1Q | 0.235 | ||||
ENC004783 | 0.282 | D0C8HR | 0.233 | ||||
ENC003908 | 0.280 | D00GOS | 0.230 |