|
Name |
Ankaflavin
|
Molecular Formula | C23H30O5 | |
IUPAC Name* |
(3S,3aR,9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione
|
|
SMILES |
CCCCCCCC(=O)[C@@H]1[C@H]2CC3=C(COC(=C3)/C=C/C)C(=O)[C@@]2(OC1=O)C
|
|
InChI |
InChI=1S/C23H30O5/c1-4-6-7-8-9-11-19(24)20-18-13-15-12-16(10-5-2)27-14-17(15)21(25)23(18,3)28-22(20)26/h5,10,12,18,20H,4,6-9,11,13-14H2,1-3H3/b10-5+/t18-,20+,23-/m1/s1
|
|
InChIKey |
AQTJNEHGKRUSLT-ODTNPMSZSA-N
|
|
Synonyms |
ANKAFLAVIN; 50980-32-0; (3S,3aR,9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione; (3S,3aR,9aR)-9a-Methyl-3-octanoyl-6-((E)-prop-1-en-1-yl)-3a,4,8,9a-tetrahydro-2H-furo[3,2-g]isochromene-2,9(3H)-dione; CHEMBL1215462; HY-N6642; AKOS037515363; XA165909; CS-0062873
|
|
CAS | NA | |
PubChem CID | 15294091 | |
ChEMBL ID | CHEMBL1215462 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 386.5 | ALogp: | 4.3 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.341 |
Caco-2 Permeability: | -4.851 | MDCK Permeability: | 0.00002700 |
Pgp-inhibitor: | 0.989 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.968 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.644 | Plasma Protein Binding (PPB): | 92.50% |
Volume Distribution (VD): | 1.68 | Fu: | 10.10% |
CYP1A2-inhibitor: | 0.764 | CYP1A2-substrate: | 0.671 |
CYP2C19-inhibitor: | 0.938 | CYP2C19-substrate: | 0.721 |
CYP2C9-inhibitor: | 0.753 | CYP2C9-substrate: | 0.108 |
CYP2D6-inhibitor: | 0.242 | CYP2D6-substrate: | 0.078 |
CYP3A4-inhibitor: | 0.941 | CYP3A4-substrate: | 0.57 |
Clearance (CL): | 5.847 | Half-life (T1/2): | 0.267 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.808 |
Drug-inuced Liver Injury (DILI): | 0.919 | AMES Toxicity: | 0.235 |
Rat Oral Acute Toxicity: | 0.829 | Maximum Recommended Daily Dose: | 0.927 |
Skin Sensitization: | 0.942 | Carcinogencity: | 0.427 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.409 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002208 | 0.923 | D03ZJE | 0.305 | ||||
ENC005594 | 0.540 | D0L7AS | 0.288 | ||||
ENC002209 | 0.458 | D02AXG | 0.274 | ||||
ENC001880 | 0.402 | D0I4DQ | 0.267 | ||||
ENC002726 | 0.363 | D09ANG | 0.267 | ||||
ENC004245 | 0.339 | D00CTS | 0.256 | ||||
ENC005464 | 0.314 | D0P1FO | 0.246 | ||||
ENC002613 | 0.311 | D0UU9Y | 0.243 | ||||
ENC002132 | 0.310 | D00AEQ | 0.242 | ||||
ENC002211 | 0.308 | D0ZI4H | 0.236 |