|
Name |
5,7,4'-Trimethoxy-4-phenylcoumarin
|
Molecular Formula | C18H16O5 | |
IUPAC Name* |
5,7-dimethoxy-4-(4-methoxyphenyl)chromen-2-one
|
|
SMILES |
COC1=CC=C(C=C1)C2=CC(=O)OC3=C2C(=CC(=C3)OC)OC
|
|
InChI |
InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)14-10-17(19)23-16-9-13(21-2)8-15(22-3)18(14)16/h4-10H,1-3H3
|
|
InChIKey |
LUAQJOITTQBGCV-UHFFFAOYSA-N
|
|
Synonyms |
5,7,4'-Trimethoxy-4-phenylcoumarin; 74512-60-0; DTXSID10475649; LMPK12100048; 5,7-dimethoxy-4-p-methoxylphenylcoumarin; 4-(4-Methoxyphenyl)-5,7-dimethoxycoumarin
|
|
CAS | 74512-60-0 | |
PubChem CID | 12004232 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 312.3 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 54.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.675 |
Caco-2 Permeability: | -4.715 | MDCK Permeability: | 0.00006090 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.131 | Plasma Protein Binding (PPB): | 85.39% |
Volume Distribution (VD): | 0.943 | Fu: | 9.20% |
CYP1A2-inhibitor: | 0.951 | CYP1A2-substrate: | 0.969 |
CYP2C19-inhibitor: | 0.809 | CYP2C19-substrate: | 0.319 |
CYP2C9-inhibitor: | 0.695 | CYP2C9-substrate: | 0.938 |
CYP2D6-inhibitor: | 0.668 | CYP2D6-substrate: | 0.947 |
CYP3A4-inhibitor: | 0.815 | CYP3A4-substrate: | 0.555 |
Clearance (CL): | 10.119 | Half-life (T1/2): | 0.336 |
hERG Blockers: | 0.423 | Human Hepatotoxicity (H-HT): | 0.191 |
Drug-inuced Liver Injury (DILI): | 0.909 | AMES Toxicity: | 0.591 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.356 |
Skin Sensitization: | 0.467 | Carcinogencity: | 0.077 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.866 |
Respiratory Toxicity: | 0.39 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001442 | 0.689 | D06GCK | 0.441 | ||||
ENC001405 | 0.688 | D0NJ3V | 0.347 | ||||
ENC000982 | 0.535 | D0A8FB | 0.336 | ||||
ENC001772 | 0.506 | D0R2OA | 0.330 | ||||
ENC005880 | 0.469 | D09WKB | 0.322 | ||||
ENC005870 | 0.468 | D0VU8Q | 0.322 | ||||
ENC005871 | 0.468 | D0W7JZ | 0.311 | ||||
ENC002952 | 0.454 | D02LZB | 0.308 | ||||
ENC006013 | 0.447 | D04UTT | 0.300 | ||||
ENC000962 | 0.447 | D0G4KG | 0.297 |