|
Name |
Asperpentyn
|
Molecular Formula | C11H12O3 | |
IUPAC Name* |
(1S,2R,5S,6R)-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol
|
|
SMILES |
CC(=C)C#CC1=C[C@@H]([C@@H]2[C@H]([C@@H]1O)O2)O
|
|
InChI |
InChI=1S/C11H12O3/c1-6(2)3-4-7-5-8(12)10-11(14-10)9(7)13/h5,8-13H,1H2,2H3/t8-,9+,10+,11-/m0/s1
|
|
InChIKey |
KPEYCTJGQFOOBS-ZDCRXTMVSA-N
|
|
Synonyms |
Asperpentyn; (1S,2R,5S,6R)-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol; 119483-44-2
|
|
CAS | NA | |
PubChem CID | 11480953 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.21 | ALogp: | 0.3 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 53.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.431 |
Caco-2 Permeability: | -5.028 | MDCK Permeability: | 0.00001120 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.536 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.132 |
Blood-Brain-Barrier Penetration (BBB): | 0.14 | Plasma Protein Binding (PPB): | 69.28% |
Volume Distribution (VD): | 1.321 | Fu: | 11.86% |
CYP1A2-inhibitor: | 0.402 | CYP1A2-substrate: | 0.093 |
CYP2C19-inhibitor: | 0.132 | CYP2C19-substrate: | 0.741 |
CYP2C9-inhibitor: | 0.208 | CYP2C9-substrate: | 0.184 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.249 |
CYP3A4-inhibitor: | 0.047 | CYP3A4-substrate: | 0.219 |
Clearance (CL): | 5.746 | Half-life (T1/2): | 0.604 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.946 |
Drug-inuced Liver Injury (DILI): | 0.797 | AMES Toxicity: | 0.351 |
Rat Oral Acute Toxicity: | 0.945 | Maximum Recommended Daily Dose: | 0.945 |
Skin Sensitization: | 0.952 | Carcinogencity: | 0.686 |
Eye Corrosion: | 0.955 | Eye Irritation: | 0.978 |
Respiratory Toxicity: | 0.987 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002103 | 0.490 | D05ZYM | 0.203 | ||||
ENC004335 | 0.453 | D02HYK | 0.189 | ||||
ENC004334 | 0.453 | D03KXY | 0.186 | ||||
ENC003298 | 0.400 | D0H3WI | 0.183 | ||||
ENC002872 | 0.382 | D0S7DV | 0.183 | ||||
ENC004553 | 0.371 | D0G5AG | 0.178 | ||||
ENC004552 | 0.352 | D0Z4EI | 0.175 | ||||
ENC004558 | 0.347 | D05ZJG | 0.170 | ||||
ENC006076 | 0.310 | D07NSU | 0.169 | ||||
ENC004551 | 0.308 | D0H2RI | 0.169 |