|
Name |
Dicerandrol C
|
Molecular Formula | C38H38O16 | |
IUPAC Name* |
[(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate
|
|
SMILES |
C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)O[C@@]6([C@@H]([C@@H](CC(=O)C6=C5O)C)OC(=O)C)COC(=O)C)O)O[C@@]2([C@@H]1OC(=O)C)COC(=O)C)O
|
|
InChI |
InChI=1S/C38H38O16/c1-15-11-23(43)29-33(47)27-25(53-37(29,13-49-17(3)39)35(15)51-19(5)41)9-7-21(31(27)45)22-8-10-26-28(32(22)46)34(48)30-24(44)12-16(2)36(52-20(6)42)38(30,54-26)14-50-18(4)40/h7-10,15-16,35-36,45-48H,11-14H2,1-6H3/t15-,16-,35-,36-,37+,38+/m1/s1
|
|
InChIKey |
KYQPTDIMYDSMHS-ACMZUNAXSA-N
|
|
Synonyms |
Dicerandrol C; CHEBI:65766; (5R,5'R,6R,6'R,10aR,10a'R)-10a,10a'-bis[(acetyloxy)methyl]-1,1',8,8'-tetrahydroxy-6,6'-dimethyl-9,9'-dioxo-5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,2'-bixanthene-5,5'-diyl diacetate; Dicerandrols C; CHEMBL507894; DTXSID401336290; Q27134253; [(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate; 361445-55-8
|
|
CAS | 361445-55-8 | |
PubChem CID | 11093875 | |
ChEMBL ID | CHEMBL507894 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 750.7 | ALogp: | 2.7 |
HBD: | 4 | HBA: | 16 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 239.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 54 | QED Weighted: | 0.226 |
Caco-2 Permeability: | -5.393 | MDCK Permeability: | 0.00003580 |
Pgp-inhibitor: | 0.948 | Pgp-substrate: | 0.342 |
Human Intestinal Absorption (HIA): | 0.714 | 20% Bioavailability (F20%): | 0.423 |
30% Bioavailability (F30%): | 0.874 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 80.46% |
Volume Distribution (VD): | 0.486 | Fu: | 17.35% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.036 |
CYP2C19-inhibitor: | 0.136 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.7 | CYP2C9-substrate: | 0.249 |
CYP2D6-inhibitor: | 0.361 | CYP2D6-substrate: | 0.084 |
CYP3A4-inhibitor: | 0.657 | CYP3A4-substrate: | 0.377 |
Clearance (CL): | 1.855 | Half-life (T1/2): | 0.133 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.995 |
Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.028 |
Rat Oral Acute Toxicity: | 0.975 | Maximum Recommended Daily Dose: | 0.113 |
Skin Sensitization: | 0.027 | Carcinogencity: | 0.017 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001969 | 0.896 | D07IPB | 0.257 | ||||
ENC001973 | 0.881 | D0Q0PR | 0.256 | ||||
ENC004764 | 0.825 | D0T5XN | 0.247 | ||||
ENC001968 | 0.802 | D0FX2Q | 0.246 | ||||
ENC002870 | 0.786 | D01XWG | 0.245 | ||||
ENC001991 | 0.769 | D01XDL | 0.245 | ||||
ENC002978 | 0.701 | D0OL7F | 0.241 | ||||
ENC005075 | 0.678 | D07VLY | 0.235 | ||||
ENC005074 | 0.587 | D0C9XJ | 0.235 | ||||
ENC003646 | 0.583 | D01UBX | 0.235 |