|
Name |
Sulfurous acid, octadecyl 2-propyl ester
|
Molecular Formula | C21H44O3S | |
IUPAC Name* |
octadecyl propan-2-yl sulfite
|
|
SMILES |
CCCCCCCCCCCCCCCCCCOS(=O)OC(C)C
|
|
InChI |
InChI=1S/C21H44O3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-25(22)24-21(2)3/h21H,4-20H2,1-3H3
|
|
InChIKey |
NDGWBWGCQGULBA-UHFFFAOYSA-N
|
|
Synonyms |
Sulfurous acid, octadecyl 2-propyl ester; isopropyl octadecyl sulfite
|
|
CAS | NA | |
PubChem CID | 6420358 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 376.6 | ALogp: | 9.8 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 20 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 54.7 | Aromatic Rings: | 0 |
Heavy Atoms: | 25 | QED Weighted: | 0.209 |
Caco-2 Permeability: | -4.878 | MDCK Permeability: | 0.00001450 |
Pgp-inhibitor: | 0.035 | Pgp-substrate: | 0.588 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.088 |
30% Bioavailability (F30%): | 0.972 |
Blood-Brain-Barrier Penetration (BBB): | 0.154 | Plasma Protein Binding (PPB): | 99.45% |
Volume Distribution (VD): | 2.289 | Fu: | 1.06% |
CYP1A2-inhibitor: | 0.092 | CYP1A2-substrate: | 0.309 |
CYP2C19-inhibitor: | 0.179 | CYP2C19-substrate: | 0.417 |
CYP2C9-inhibitor: | 0.097 | CYP2C9-substrate: | 0.923 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.03 |
CYP3A4-inhibitor: | 0.092 | CYP3A4-substrate: | 0.053 |
Clearance (CL): | 5.477 | Half-life (T1/2): | 0.021 |
hERG Blockers: | 0.249 | Human Hepatotoxicity (H-HT): | 0.699 |
Drug-inuced Liver Injury (DILI): | 0.951 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.032 |
Skin Sensitization: | 0.952 | Carcinogencity: | 0.55 |
Eye Corrosion: | 0.986 | Eye Irritation: | 0.976 |
Respiratory Toxicity: | 0.901 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001790 | 0.789 | D00FGR | 0.570 | ||||
ENC001124 | 0.724 | D00AOJ | 0.568 | ||||
ENC000428 | 0.680 | D0Z5SM | 0.506 | ||||
ENC000666 | 0.679 | D07ILQ | 0.506 | ||||
ENC001792 | 0.662 | D05ATI | 0.439 | ||||
ENC000284 | 0.658 | D0T9TJ | 0.385 | ||||
ENC000429 | 0.658 | D0O1PH | 0.384 | ||||
ENC000521 | 0.658 | D00STJ | 0.381 | ||||
ENC000527 | 0.658 | D00MLW | 0.348 | ||||
ENC000497 | 0.654 | D0P1RL | 0.327 |