|
Name |
Stigmast-4-en-3-one
|
Molecular Formula | C29H48O | |
IUPAC Name* |
(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
|
|
SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)C(C)C
|
|
InChI |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h18-21,24-27H,7-17H2,1-6H3/t20-,21-,24+,25-,26+,27+,28+,29-/m1/s1
|
|
InChIKey |
RUVUHIUYGJBLGI-XJZKHKOHSA-N
|
|
Synonyms |
Stigmast-4-en-3-one; Sitostenone; 1058-61-3; beta-sitostenone; 4-Stigmasten-3-one; CHEBI:68105; NSC 49082; 24-Eceo; 4-stigmasta-ene-3-one; .DELTA.4-Sitosterol-3-one; CHEMBL66926; SCHEMBL873360; 24-Ethyl-4-cholesten-3-one; 3-oxo-24-ethyl-cholest-4-ene; DTXSID50862519; Stigmast-4-en-3-one, (24xi)-; ZINC4073977; (8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one; 67392-96-5; 24(R)-Stigmast-7,22 (E)-dien-3a-ol; Q27136596; (8S,9S,10R,13R,14S,17R)-17-((2R,5R)-5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one; (8S,9S,10R,13R,14S,17R)-17-[(1R,4R)-4-ethyl-1,5-dimethyl-hexyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
|
|
CAS | 1058-61-3 | |
PubChem CID | 5484202 | |
ChEMBL ID | CHEMBL66926 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 412.7 | ALogp: | 9.3 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 17.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.403 |
Caco-2 Permeability: | -4.783 | MDCK Permeability: | 0.00000831 |
Pgp-inhibitor: | 0.957 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.978 |
30% Bioavailability (F30%): | 0.931 |
Blood-Brain-Barrier Penetration (BBB): | 0.36 | Plasma Protein Binding (PPB): | 92.99% |
Volume Distribution (VD): | 1.283 | Fu: | 1.26% |
CYP1A2-inhibitor: | 0.092 | CYP1A2-substrate: | 0.546 |
CYP2C19-inhibitor: | 0.196 | CYP2C19-substrate: | 0.924 |
CYP2C9-inhibitor: | 0.247 | CYP2C9-substrate: | 0.301 |
CYP2D6-inhibitor: | 0.111 | CYP2D6-substrate: | 0.345 |
CYP3A4-inhibitor: | 0.642 | CYP3A4-substrate: | 0.797 |
Clearance (CL): | 6.383 | Half-life (T1/2): | 0.172 |
hERG Blockers: | 0.875 | Human Hepatotoxicity (H-HT): | 0.25 |
Drug-inuced Liver Injury (DILI): | 0.866 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.964 | Carcinogencity: | 0.131 |
Eye Corrosion: | 0.958 | Eye Irritation: | 0.918 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005239 | 1.000 | D0Y7LD | 0.694 | ||||
ENC003458 | 0.729 | D06XMU | 0.596 | ||||
ENC001008 | 0.694 | D07BSQ | 0.581 | ||||
ENC001647 | 0.657 | D02CJX | 0.534 | ||||
ENC003337 | 0.647 | D0W5LS | 0.528 | ||||
ENC001170 | 0.640 | D0Z1XD | 0.500 | ||||
ENC000961 | 0.583 | D02AXG | 0.487 | ||||
ENC000125 | 0.548 | D00AEQ | 0.457 | ||||
ENC001475 | 0.536 | D0G8BV | 0.455 | ||||
ENC001769 | 0.531 | D08TEJ | 0.455 |