|
Name |
4-Hepten-3-one, 5-methyl-
|
Molecular Formula | C8H14O | |
IUPAC Name* |
(E)-5-methylhept-4-en-3-one
|
|
SMILES |
CC/C(=C/C(=O)CC)/C
|
|
InChI |
InChI=1S/C8H14O/c1-4-7(3)6-8(9)5-2/h6H,4-5H2,1-3H3/b7-6+
|
|
InChIKey |
XJEHTASYOBAEDB-VOTSOKGWSA-N
|
|
Synonyms |
4-Hepten-3-one, 5-methyl-; 1447-26-3; (E)-5-methylhept-4-en-3-one; (E)-5-Methyl-4-hepten-3-one; 20685-44-3; 5-methyl-4-hepten-3-one; 5-methylhept-4-en-3-one; 4-Hepten-3-one, 5-methyl-, (E)-; starbld0044620; 5-Methyl-4-hepten-3-on; 3-Methyl-3-hepten-5-one; (4E)-5-Methyl-4-hepten-3-one; (4E)-5-methylhept-4-en-3-one; ZINC96327924; (4E)-5-Methyl-4-hepten-3-one #
|
|
CAS | 1447-26-3 | |
PubChem CID | 5364923 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 126.2 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.531 |
Caco-2 Permeability: | -4.39 | MDCK Permeability: | 0.00002720 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.02 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.859 |
30% Bioavailability (F30%): | 0.051 |
Blood-Brain-Barrier Penetration (BBB): | 0.995 | Plasma Protein Binding (PPB): | 59.11% |
Volume Distribution (VD): | 1.027 | Fu: | 39.50% |
CYP1A2-inhibitor: | 0.291 | CYP1A2-substrate: | 0.172 |
CYP2C19-inhibitor: | 0.108 | CYP2C19-substrate: | 0.713 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.529 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.343 |
CYP3A4-inhibitor: | 0.02 | CYP3A4-substrate: | 0.249 |
Clearance (CL): | 9.717 | Half-life (T1/2): | 0.895 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.073 |
Drug-inuced Liver Injury (DILI): | 0.497 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.034 | Maximum Recommended Daily Dose: | 0.027 |
Skin Sensitization: | 0.896 | Carcinogencity: | 0.066 |
Eye Corrosion: | 0.981 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.655 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002251 | 0.378 | D0ZK8H | 0.265 | ||||
ENC000313 | 0.333 | D0Q9HF | 0.231 | ||||
ENC001203 | 0.324 | D0Y3KG | 0.225 | ||||
ENC000224 | 0.323 | D0F1GS | 0.212 | ||||
ENC001585 | 0.314 | D0Z4NI | 0.212 | ||||
ENC005107 | 0.314 | D0G4JI | 0.200 | ||||
ENC001556 | 0.314 | D0U7BW | 0.200 | ||||
ENC001734 | 0.308 | D0XB8P | 0.200 | ||||
ENC001735 | 0.308 | D06RCB | 0.196 | ||||
ENC000225 | 0.303 | D0M1PQ | 0.195 |