|
Name |
Elaidamide
|
Molecular Formula | C18H35NO | |
IUPAC Name* |
(E)-octadec-9-enamide
|
|
SMILES |
CCCCCCCC/C=C/CCCCCCCC(=O)N
|
|
InChI |
InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H2,19,20)/b10-9+
|
|
InChIKey |
FATBGEAMYMYZAF-MDZDMXLPSA-N
|
|
Synonyms |
ELAIDAMIDE; 4303-70-2; 9-Octadecenamide; (E)-9-Octadecenamide; octadec-9-enamide; (E)-octadec-9-enamide; (9E)-9-Octadecenamide; 9E-hexadecenamide; elaidic acid amide; GOU8K597IT; (9E)-OCTADEC-9-ENAMIDE; UNII-GOU8K597IT; Armid ow; 9-Oleoamide; EINECS 224-316-5; trans-9-octadecenamide; 9-Octadecenamide, (9E)-; SCHEMBL19788; CHEMBL86554; SCHEMBL195221; CHEBI:165592; DTXSID901017170; (E)-9,10-OCTADECENAMIDE; LMFA08010011; ZINC14880924; AKOS000277608; DB03784; BS-16886; CS-0166850; D83824; Q27094678
|
|
CAS | 4303-70-2 | |
PubChem CID | 5353370 | |
ChEMBL ID | CHEMBL86554 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 281.5 | ALogp: | 6.6 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 43.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.303 |
Caco-2 Permeability: | -4.804 | MDCK Permeability: | 0.00002710 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.838 |
30% Bioavailability (F30%): | 0.993 |
Blood-Brain-Barrier Penetration (BBB): | 0.447 | Plasma Protein Binding (PPB): | 99.66% |
Volume Distribution (VD): | 3.035 | Fu: | 0.75% |
CYP1A2-inhibitor: | 0.367 | CYP1A2-substrate: | 0.202 |
CYP2C19-inhibitor: | 0.412 | CYP2C19-substrate: | 0.054 |
CYP2C9-inhibitor: | 0.227 | CYP2C9-substrate: | 0.941 |
CYP2D6-inhibitor: | 0.222 | CYP2D6-substrate: | 0.199 |
CYP3A4-inhibitor: | 0.375 | CYP3A4-substrate: | 0.034 |
Clearance (CL): | 3.191 | Half-life (T1/2): | 0.28 |
hERG Blockers: | 0.23 | Human Hepatotoxicity (H-HT): | 0.032 |
Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.029 |
Skin Sensitization: | 0.942 | Carcinogencity: | 0.035 |
Eye Corrosion: | 0.094 | Eye Irritation: | 0.877 |
Respiratory Toxicity: | 0.099 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001602 | 1.000 | D0O1PH | 0.757 | ||||
ENC002845 | 0.895 | D0O1TC | 0.538 | ||||
ENC001555 | 0.839 | D07ILQ | 0.519 | ||||
ENC001699 | 0.839 | D0OR6A | 0.468 | ||||
ENC001710 | 0.826 | D0UE9X | 0.462 | ||||
ENC001688 | 0.800 | D0Z5SM | 0.461 | ||||
ENC001775 | 0.781 | D05ATI | 0.444 | ||||
ENC001593 | 0.765 | D00AOJ | 0.393 | ||||
ENC001670 | 0.765 | D0Z5BC | 0.388 | ||||
ENC001687 | 0.746 | D09SRR | 0.375 |