|
Name |
9R-hydroxy-10E-octadecenoic acid
|
Molecular Formula | C18H34O3 | |
IUPAC Name* |
(E,9R)-9-hydroxyoctadec-10-enoic acid
|
|
SMILES |
CCCCCCC/C=C/[C@@H](CCCCCCCC(=O)O)O
|
|
InChI |
InChI=1S/C18H34O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h11,14,17,19H,2-10,12-13,15-16H2,1H3,(H,20,21)/b14-11+/t17-/m0/s1
|
|
InChIKey |
UYTAXAWTQDKVBD-WKOYGUFESA-N
|
|
Synonyms |
9R-HOME(10E); 9R-hydroxy-10E-octadecenoic acid; 10-Octadecenoic acid, 9-hydroxy-, [R-(E)]-; (E,9R)-9-hydroxyoctadec-10-enoic acid; CHEBI:165775; LMFA02000205; (9r,10e)-9-hydroxyoctadec-10-enoic acid
|
|
CAS | NA | |
PubChem CID | 5312845 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 298.5 | ALogp: | 5.8 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 57.5 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.314 |
Caco-2 Permeability: | -5.25 | MDCK Permeability: | 0.00004640 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.117 | 20% Bioavailability (F20%): | 0.994 |
30% Bioavailability (F30%): | 0.961 |
Blood-Brain-Barrier Penetration (BBB): | 0.114 | Plasma Protein Binding (PPB): | 99.43% |
Volume Distribution (VD): | 0.427 | Fu: | 1.19% |
CYP1A2-inhibitor: | 0.142 | CYP1A2-substrate: | 0.199 |
CYP2C19-inhibitor: | 0.073 | CYP2C19-substrate: | 0.092 |
CYP2C9-inhibitor: | 0.283 | CYP2C9-substrate: | 0.992 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.021 |
Clearance (CL): | 2.328 | Half-life (T1/2): | 0.77 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.379 |
Drug-inuced Liver Injury (DILI): | 0.024 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.147 | Maximum Recommended Daily Dose: | 0.924 |
Skin Sensitization: | 0.913 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.04 | Eye Irritation: | 0.92 |
Respiratory Toxicity: | 0.821 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001555 | 0.706 | D0O1PH | 0.645 | ||||
ENC001100 | 0.706 | D0I4DQ | 0.524 | ||||
ENC001419 | 0.706 | D0O1TC | 0.506 | ||||
ENC001592 | 0.706 | D0Z5BC | 0.484 | ||||
ENC001591 | 0.706 | D07ILQ | 0.469 | ||||
ENC001099 | 0.692 | D0XN8C | 0.457 | ||||
ENC001589 | 0.692 | D06FEA | 0.438 | ||||
ENC001775 | 0.681 | D0UE9X | 0.432 | ||||
ENC002562 | 0.667 | D09SRR | 0.426 | ||||
ENC001614 | 0.662 | D05ATI | 0.413 |