|
Name |
Petroselaidic acid
|
Molecular Formula | C18H34O2 | |
IUPAC Name* |
(E)-octadec-6-enoic acid
|
|
SMILES |
CCCCCCCCCCC/C=C/CCCCC(=O)O
|
|
InChI |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3,(H,19,20)/b13-12+
|
|
InChIKey |
CNVZJPUDSLNTQU-OUKQBFOZSA-N
|
|
Synonyms |
Petroselaidic acid; 6-Octadecenoic acid; 593-40-8; (E)-octadec-6-enoic acid; 6E-Octadecenoic acid; trans-6-octadecenoic acid; 4712-34-9; (6E)-octadec-6-enoic acid; C18:1n-6; Petroselenic acid; C18:1n-12; 6-Octadecensaeure; Octadec-6-ensaeure; cis-6-Octadecenoate; Octadec-6t-ensaeure; octadec-6t-enoic acid; (6Z)-6-Octadecenoate; (E)-6-Octadecenoic acid; trans-octadec-6-enoic acid; (6E)-6-Octadecenoic acid; SCHEMBL141007; SCHEMBL417062; CHEBI:30829; CHEBI:36022; trans-Delta(6)-octadecenoic acid; DTXSID601009340; LMFA01030067; s3342; ZINC32787113; AKOS015903063; LS-14687; 18:1n-6; CS-0454038; Q27113999
|
|
CAS | 593-40-8 | |
PubChem CID | 5282754 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.5 | ALogp: | 7.3 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.289 |
Caco-2 Permeability: | -5.096 | MDCK Permeability: | 0.00002950 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.757 |
30% Bioavailability (F30%): | 0.96 |
Blood-Brain-Barrier Penetration (BBB): | 0.02 | Plasma Protein Binding (PPB): | 99.94% |
Volume Distribution (VD): | 0.858 | Fu: | 0.59% |
CYP1A2-inhibitor: | 0.284 | CYP1A2-substrate: | 0.189 |
CYP2C19-inhibitor: | 0.202 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.217 | CYP2C9-substrate: | 0.993 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.051 | CYP3A4-substrate: | 0.017 |
Clearance (CL): | 2.414 | Half-life (T1/2): | 0.768 |
hERG Blockers: | 0.048 | Human Hepatotoxicity (H-HT): | 0.035 |
Drug-inuced Liver Injury (DILI): | 0.018 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.021 |
Skin Sensitization: | 0.932 | Carcinogencity: | 0.044 |
Eye Corrosion: | 0.964 | Eye Irritation: | 0.959 |
Respiratory Toxicity: | 0.834 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001555 | 1.000 | D0O1PH | 0.864 | ||||
ENC001775 | 0.932 | D0O1TC | 0.644 | ||||
ENC001593 | 0.905 | D0UE9X | 0.562 | ||||
ENC001099 | 0.895 | D07ILQ | 0.539 | ||||
ENC001699 | 0.839 | D0Z5BC | 0.500 | ||||
ENC001602 | 0.839 | D0OR6A | 0.468 | ||||
ENC001553 | 0.826 | D0Z5SM | 0.461 | ||||
ENC001688 | 0.800 | D09SRR | 0.451 | ||||
ENC001670 | 0.765 | D0XN8C | 0.450 | ||||
ENC001554 | 0.759 | D05ATI | 0.444 |