|
Name |
Octadecenoic acid
|
Molecular Formula | C18H34O2 | |
IUPAC Name* |
(E)-octadec-2-enoic acid
|
|
SMILES |
CCCCCCCCCCCCCCC/C=C/C(=O)O
|
|
InChI |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/b17-16+
|
|
InChIKey |
LKOVPWSSZFDYPG-WUKNDPDISA-N
|
|
Synonyms |
OCTADECENOIC ACID; 2-Octadecenoic acid; (E)-octadec-2-enoic acid; trans-2-octadecenoic acid; trans-2-oleic acid; octadec-2-enoic acid; (E)-2-octadecenoic acid; trans-octadec-2-enoic acid; 27251-59-8; CHEMBL4292703; 2Z-octadecenoic acid; 2825-79-8; C18:1n-16; NSC931; Octadecenoic acid, (E)-; 2-Octadecensaeure; 2-octadecenic acid; 5340-63-6; Octadec-2-ensaeure; Octadec-2t-ensaeure; octadec-2t-enoic acid; starbld0007012; 2-trans-octadecenoic acid; SCHEMBL41749; (2E)-octadec-2-enoic acid; 18:1 (n-16), trans; C18:1 (n-16), trans; CHEBI:50572; CHEBI:50573; trans-Heptadecen-(1)-carbonsaeure; BDBM50466179; LMFA01030062; ZINC59359373; C18:1, n-16; Q27122121; Q27122122
|
|
CAS | 27251-59-8 | |
PubChem CID | 5282750 | |
ChEMBL ID | CHEMBL4292703 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.5 | ALogp: | 8.1 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.289 |
Caco-2 Permeability: | -4.862 | MDCK Permeability: | 0.00002220 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.067 |
30% Bioavailability (F30%): | 0.702 |
Blood-Brain-Barrier Penetration (BBB): | 0.119 | Plasma Protein Binding (PPB): | 98.83% |
Volume Distribution (VD): | 0.643 | Fu: | 1.17% |
CYP1A2-inhibitor: | 0.32 | CYP1A2-substrate: | 0.17 |
CYP2C19-inhibitor: | 0.236 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.245 | CYP2C9-substrate: | 0.988 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.051 |
CYP3A4-inhibitor: | 0.053 | CYP3A4-substrate: | 0.016 |
Clearance (CL): | 2.796 | Half-life (T1/2): | 0.493 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.014 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.949 | Carcinogencity: | 0.103 |
Eye Corrosion: | 0.991 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.708 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002790 | 0.765 | D07ILQ | 0.625 | ||||
ENC000050 | 0.742 | D0O1PH | 0.597 | ||||
ENC001593 | 0.714 | D0Z5SM | 0.542 | ||||
ENC000557 | 0.710 | D00AOJ | 0.512 | ||||
ENC000356 | 0.708 | D00FGR | 0.467 | ||||
ENC001553 | 0.703 | D05ATI | 0.465 | ||||
ENC000466 | 0.694 | D0O1TC | 0.429 | ||||
ENC001707 | 0.691 | D0P1RL | 0.407 | ||||
ENC000426 | 0.689 | D0Z5BC | 0.388 | ||||
ENC000688 | 0.688 | D0XN8C | 0.365 |