|
Name |
trans-2-Hexenoic acid
|
Molecular Formula | C6H10O2 | |
IUPAC Name* |
(E)-hex-2-enoic acid
|
|
SMILES |
CCC/C=C/C(=O)O
|
|
InChI |
InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/b5-4+
|
|
InChIKey |
NIONDZDPPYHYKY-SNAWJCMRSA-N
|
|
Synonyms |
trans-2-Hexenoic acid; 13419-69-7; (E)-hex-2-enoic acid; 2-HEXENOIC ACID; hex-2-enoic acid; trans-Hex-2-enoic acid; 1191-04-4; 2-Hexenoic acid, (2E)-; (E)-2-Hexenoic acid; Hexenoic acid; (2E)-2-Hexenoic acid; (2E)-hex-2-enoic acid; 2-Hexenoic acid, (E)-; 2E-hexenoic acid; Isohydrosorbic acid; (2E)-HEXENOIC ACID; FEMA No. 3169; beta-propyl acrylic acid; 2-Hexenoic acid, trans-; VQ24908VRU; CHEBI:87721; C6:1n-4; trans-2-hexenoicacid; 3-Propylacrylic acid; Propylacrylic acid, beta-; UNII-VQ24908VRU; UNII-BXY1L20879; hex-2-enoicacid; Hex-2-ensaeure; (E)-hexenoic acid; EINECS 214-727-8; EINECS 236-528-5; alpha.beta-Hexensaeure; beta-propylacrylic acid; alpha,beta-hexenoic acid; AI3-36119; SCHEMBL23614; SCHEMBL23615; trans-2-Hexenoic acid, 99%; QSPL 013; CHEMBL2252747; CHEBI:61206; NIONDZDPPYHYKY-SNAWJCMRSA-; DTXSID60884601; HEXENOIC ACID, TRANS 2-; BXY1L20879; ZINC1850698; LMFA01030008; MFCD00002705; AKOS000121254; TRANS-2-HEXENOIC ACID [FHFI]; C6:1, n-4; CS-W011247; trans-2-Hexenoic acid, >=98%, FG; 1289-40-3; BS-19492; CS-17340; DB-002108; H0383; EN300-21643; EN300-304058; A806747; Q-103481; Q27130883; Q27159869; Z104506794
|
|
CAS | 13419-69-7 | |
PubChem CID | 5282707 | |
ChEMBL ID | CHEMBL2252747 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 114.14 | ALogp: | 1.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 8 | QED Weighted: | 0.569 |
Caco-2 Permeability: | -4.614 | MDCK Permeability: | 0.00009290 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.844 | Plasma Protein Binding (PPB): | 38.10% |
Volume Distribution (VD): | 0.245 | Fu: | 40.17% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.116 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.087 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.924 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.195 |
CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.051 |
Clearance (CL): | 9.438 | Half-life (T1/2): | 0.85 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.339 | Carcinogencity: | 0.176 |
Eye Corrosion: | 0.993 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.134 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001587 | 0.543 | D0Y3KG | 0.270 | ||||
ENC001698 | 0.500 | D04CRL | 0.261 | ||||
ENC001588 | 0.463 | D0N3NO | 0.250 | ||||
ENC001585 | 0.419 | D01ZJK | 0.238 | ||||
ENC000018 | 0.385 | D0M8AB | 0.231 | ||||
ENC001668 | 0.378 | D0R3QY | 0.222 | ||||
ENC001642 | 0.378 | D01OPV | 0.222 | ||||
ENC005738 | 0.351 | D0UE9X | 0.219 | ||||
ENC001725 | 0.344 | D0EP8X | 0.219 | ||||
ENC000058 | 0.333 | D0V9EN | 0.217 |