|
Name |
Fallacinol
|
Molecular Formula | C16H12O6 | |
IUPAC Name* |
1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione
|
|
SMILES |
COC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)CO
|
|
InChI |
InChI=1S/C16H12O6/c1-22-8-4-10-14(12(19)5-8)16(21)13-9(15(10)20)2-7(6-17)3-11(13)18/h2-5,17-19H,6H2,1H3
|
|
InChIKey |
WJXSYUJKJSOJOG-UHFFFAOYSA-N
|
|
Synonyms |
Fallacinol; Teloschistin; 569-05-1; 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione; Phallacinol; Chrysazin, 3-(hydroxymethyl)-6-methoxy-; SCHEMBL16225969; DTXSID80205430; CHEBI:144153; 1,8-Dihydroxy-3-(hydroxymethyl)-6-methoxy-9,10-anthracenedione; Anthraquinone, 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxy-; 9,10-Anthracenedione, 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxy-; NCGC00384926-01!1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione
|
|
CAS | 569-05-1 | |
PubChem CID | 3083633 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 300.26 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.667 |
Caco-2 Permeability: | -5.255 | MDCK Permeability: | 0.00000463 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.649 | 20% Bioavailability (F20%): | 0.233 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 93.83% |
Volume Distribution (VD): | 0.52 | Fu: | 8.99% |
CYP1A2-inhibitor: | 0.953 | CYP1A2-substrate: | 0.504 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.465 | CYP2C9-substrate: | 0.598 |
CYP2D6-inhibitor: | 0.094 | CYP2D6-substrate: | 0.198 |
CYP3A4-inhibitor: | 0.119 | CYP3A4-substrate: | 0.04 |
Clearance (CL): | 5.98 | Half-life (T1/2): | 0.783 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.03 |
Drug-inuced Liver Injury (DILI): | 0.713 | AMES Toxicity: | 0.483 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.911 |
Skin Sensitization: | 0.921 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.053 | Eye Irritation: | 0.934 |
Respiratory Toxicity: | 0.789 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002229 | 0.812 | D07MGA | 0.330 | ||||
ENC001058 | 0.773 | D0N1FS | 0.304 | ||||
ENC000362 | 0.773 | D0AZ8C | 0.285 | ||||
ENC000913 | 0.765 | D04AIT | 0.283 | ||||
ENC005602 | 0.739 | D06GCK | 0.277 | ||||
ENC001971 | 0.739 | D0K8KX | 0.277 | ||||
ENC000966 | 0.653 | D0R3JB | 0.271 | ||||
ENC005227 | 0.648 | D0C9XJ | 0.258 | ||||
ENC000930 | 0.648 | D07VLY | 0.258 | ||||
ENC000336 | 0.630 | D0U0OT | 0.250 |