|
Name |
Benzeneethanamine, N-[(pentafluorophenyl)methylene]-beta,4-bis[(trimethylsilyl)oxy]-
|
Molecular Formula | C21H26F5NO2Si2 | |
IUPAC Name* |
1-(2,3,4,5,6-pentafluorophenyl)-N-[2-trimethylsilyloxy-2-(4-trimethylsilyloxyphenyl)ethyl]methanimine
|
|
SMILES |
C[Si](C)(C)OC1=CC=C(C=C1)C(CN=CC2=C(C(=C(C(=C2F)F)F)F)F)O[Si](C)(C)C
|
|
InChI |
InChI=1S/C21H26F5NO2Si2/c1-30(2,3)28-14-9-7-13(8-10-14)16(29-31(4,5)6)12-27-11-15-17(22)19(24)21(26)20(25)18(15)23/h7-11,16H,12H2,1-6H3
|
|
InChIKey |
LKJPSAODMMZLQD-UHFFFAOYSA-N
|
|
Synonyms |
Benzeneethanamine, N-[(pentafluorophenyl)methylene]-.beta.,4-bis[(trimethylsilyl)oxy]-; 55429-85-1; N-[(E)-(2,3,4,5,6-Pentafluorophenyl)methylidene]-2-[(trimethylsilyl)oxy]-2-(4-[(trimethylsilyl)oxy]phenyl)ethanamine #; N-[(Pentafluorophenyl)methylene]-beta,4-bis[(trimethylsilyl)oxy]benzeneethanamine; Benzeneethanamine, N-[(2,3,4,5,6-pentafluorophenyl)methylene]-?,4-bis[(trimethylsilyl)oxy]-
|
|
CAS | NA | |
PubChem CID | 622438 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 475.6 | ALogp: | 6.6 |
HBD: | 0 | HBA: | 8 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 30.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 31 | QED Weighted: | 0.142 |
Caco-2 Permeability: | -4.681 | MDCK Permeability: | 0.00002160 |
Pgp-inhibitor: | 0.557 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.021 |
30% Bioavailability (F30%): | 0.247 |
Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 101.72% |
Volume Distribution (VD): | 3.733 | Fu: | 1.62% |
CYP1A2-inhibitor: | 0.17 | CYP1A2-substrate: | 0.985 |
CYP2C19-inhibitor: | 0.82 | CYP2C19-substrate: | 0.854 |
CYP2C9-inhibitor: | 0.942 | CYP2C9-substrate: | 0.98 |
CYP2D6-inhibitor: | 0.219 | CYP2D6-substrate: | 0.89 |
CYP3A4-inhibitor: | 0.138 | CYP3A4-substrate: | 0.359 |
Clearance (CL): | 2.377 | Half-life (T1/2): | 0.03 |
hERG Blockers: | 0.065 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.062 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.912 |
Skin Sensitization: | 0.604 | Carcinogencity: | 0.532 |
Eye Corrosion: | 0.867 | Eye Irritation: | 0.979 |
Respiratory Toxicity: | 0.899 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001182 | 0.324 | D0TR5X | 0.200 | ||||
ENC001175 | 0.297 | D0P1UX | 0.190 | ||||
ENC001123 | 0.282 | D0Q1IT | 0.188 | ||||
ENC001373 | 0.276 | D03KIA | 0.188 | ||||
ENC001122 | 0.259 | D04KJO | 0.188 | ||||
ENC001149 | 0.248 | D0D1DI | 0.188 | ||||
ENC001399 | 0.237 | D0A8FB | 0.185 | ||||
ENC001385 | 0.230 | D0DJ1B | 0.183 | ||||
ENC001807 | 0.229 | D0T6XX | 0.183 | ||||
ENC005262 | 0.208 | D0C6DT | 0.183 |