|
Name |
Benzoic acid, 2,4-bis[(trimethylsilyl)oxy]-, trimethylsilyl ester
|
Molecular Formula | C16H30O4Si3 | |
IUPAC Name* |
trimethylsilyl 2,4-bis(trimethylsilyloxy)benzoate
|
|
SMILES |
C[Si](C)(C)OC1=CC(=C(C=C1)C(=O)O[Si](C)(C)C)O[Si](C)(C)C
|
|
InChI |
InChI=1S/C16H30O4Si3/c1-21(2,3)18-13-10-11-14(16(17)20-23(7,8)9)15(12-13)19-22(4,5)6/h10-12H,1-9H3
|
|
InChIKey |
VOVIHULKTZBZND-UHFFFAOYSA-N
|
|
Synonyms |
.beta.-Resorcylic acid (tms); Benzoic acid, 2,4-bis[(trimethylsilyl)oxy]-, trimethylsilyl ester; 10586-16-0; trimethylsilyl 2,4-bis(trimethylsilyloxy)benzoate; 2-Resorcylic acid, tri-TMS; DTXSID60333740; Benzoic acid, 2,4-dihydroxy, TMS; 2,4-Dihydroxybenzoic acid, 3TMS derivative; 2,4-Bis(trimethylsiloxy)trimethylsilylbenzoate; Trimethylsilyl 2,4-bis[(trimethylsilyl)oxy]benzoate #; 2,4-Bis[(trimethylsilyl)oxy]benzoic acid trimethylsilyl ester; 2,4-Dihydroxybenzoic acid, bis(trimethylsilyl) ether, trimethylsilyl ester
|
|
CAS | 10586-16-0 | |
PubChem CID | 517875 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.66 | ALogp: | 5.1 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 44.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 23 | QED Weighted: | 0.627 |
Caco-2 Permeability: | -5.326 | MDCK Permeability: | 0.00002840 |
Pgp-inhibitor: | 0.064 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.985 | 20% Bioavailability (F20%): | 0.809 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 97.70% |
Volume Distribution (VD): | 4.044 | Fu: | 11.93% |
CYP1A2-inhibitor: | 0.883 | CYP1A2-substrate: | 0.985 |
CYP2C19-inhibitor: | 0.124 | CYP2C19-substrate: | 0.77 |
CYP2C9-inhibitor: | 0.56 | CYP2C9-substrate: | 0.914 |
CYP2D6-inhibitor: | 0.034 | CYP2D6-substrate: | 0.521 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.137 |
Clearance (CL): | 2.958 | Half-life (T1/2): | 0.346 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.001 |
Drug-inuced Liver Injury (DILI): | 0.019 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0.035 |
Skin Sensitization: | 0.936 | Carcinogencity: | 0.021 |
Eye Corrosion: | 0.946 | Eye Irritation: | 0.982 |
Respiratory Toxicity: | 0.285 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001149 | 0.686 | D0N6CR | 0.232 | ||||
ENC001122 | 0.548 | D08USJ | 0.217 | ||||
ENC001182 | 0.476 | D01JFT | 0.216 | ||||
ENC001404 | 0.421 | D02XJY | 0.213 | ||||
ENC001272 | 0.349 | D09GYT | 0.207 | ||||
ENC001399 | 0.341 | D08GJO | 0.206 | ||||
ENC000530 | 0.325 | D0WY5Q | 0.202 | ||||
ENC001175 | 0.317 | D05VIX | 0.202 | ||||
ENC001270 | 0.316 | D0U9QU | 0.202 | ||||
ENC001385 | 0.316 | D0A8FB | 0.202 |