|
Name |
4-Chlorobenzoic acid, 4-hexadecyl ester
|
Molecular Formula | C23H37ClO2 | |
IUPAC Name* |
hexadecan-4-yl 4-chlorobenzoate
|
|
SMILES |
CCCCCCCCCCCCC(CCC)OC(=O)C1=CC=C(C=C1)Cl
|
|
InChI |
InChI=1S/C23H37ClO2/c1-3-5-6-7-8-9-10-11-12-13-15-22(14-4-2)26-23(25)20-16-18-21(24)19-17-20/h16-19,22H,3-15H2,1-2H3
|
|
InChIKey |
KQINXSINDWSKCZ-UHFFFAOYSA-N
|
|
Synonyms |
4-Chlorobenzoic acid, 4-hexadecyl ester; 1-Propyltridecyl 4-chlorobenzoate #
|
|
CAS | NA | |
PubChem CID | 586889 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 381.0 | ALogp: | 9.8 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 26 | QED Weighted: | 0.218 |
Caco-2 Permeability: | -4.735 | MDCK Permeability: | 0.00001330 |
Pgp-inhibitor: | 0.556 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.847 |
30% Bioavailability (F30%): | 0.952 |
Blood-Brain-Barrier Penetration (BBB): | 0.03 | Plasma Protein Binding (PPB): | 100.20% |
Volume Distribution (VD): | 2.801 | Fu: | 1.02% |
CYP1A2-inhibitor: | 0.116 | CYP1A2-substrate: | 0.188 |
CYP2C19-inhibitor: | 0.485 | CYP2C19-substrate: | 0.053 |
CYP2C9-inhibitor: | 0.112 | CYP2C9-substrate: | 0.957 |
CYP2D6-inhibitor: | 0.536 | CYP2D6-substrate: | 0.063 |
CYP3A4-inhibitor: | 0.284 | CYP3A4-substrate: | 0.1 |
Clearance (CL): | 5.853 | Half-life (T1/2): | 0.058 |
hERG Blockers: | 0.233 | Human Hepatotoxicity (H-HT): | 0.016 |
Drug-inuced Liver Injury (DILI): | 0.468 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.067 |
Skin Sensitization: | 0.948 | Carcinogencity: | 0.052 |
Eye Corrosion: | 0.056 | Eye Irritation: | 0.935 |
Respiratory Toxicity: | 0.162 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001226 | 0.585 | D0P1RL | 0.465 | ||||
ENC001369 | 0.543 | D0G2KD | 0.402 | ||||
ENC000968 | 0.525 | D0Z5SM | 0.391 | ||||
ENC000517 | 0.488 | D05ATI | 0.391 | ||||
ENC000509 | 0.485 | D06ORU | 0.388 | ||||
ENC001301 | 0.473 | D0T9TJ | 0.387 | ||||
ENC001143 | 0.471 | D07ILQ | 0.381 | ||||
ENC000803 | 0.470 | D0K8CI | 0.349 | ||||
ENC000291 | 0.467 | D0O1PH | 0.346 | ||||
ENC003063 | 0.463 | D02MLW | 0.339 |