|
Name |
1-(2-(Hydroxymethyl)phenyl)ethanol
|
Molecular Formula | C9H12O2 | |
IUPAC Name* |
1-[2-(hydroxymethyl)phenyl]ethanol
|
|
SMILES |
CC(C1=CC=CC=C1CO)O
|
|
InChI |
InChI=1S/C9H12O2/c1-7(11)9-5-3-2-4-8(9)6-10/h2-5,7,10-11H,6H2,1H3
|
|
InChIKey |
XVKYPJPUAOOGBQ-UHFFFAOYSA-N
|
|
Synonyms |
1-(2-(Hydroxymethyl)phenyl)ethanol; 1-[2-(hydroxymethyl)phenyl]ethan-1-ol; 1-[2-(Hydroxymethyl)phenyl]ethanol; 57259-71-9; SCHEMBL1561218; alpha-Methylbenzene-1,2-dimethanol; 1-(2-Hydroxymethyl-phenyl)-ethanol; AKOS006284156; 1-[2-(Hydroxymethyl)phenyl]ethanol #; 2-(1-Hydroxyethyl)hydroxymethylbenzene; SB85139; 1-(1-hydroxyethyl)-2-hydroxymethylbenzene; 1-Hydroxymethyl-2-(1'-hydroxyethyl)benzene; CS-0225784; EN300-124906; F72554
|
|
CAS | 57259-71-9 | |
PubChem CID | 576911 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 152.19 | ALogp: | 0.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.677 |
Caco-2 Permeability: | -4.552 | MDCK Permeability: | 0.00003350 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.071 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.548 | Plasma Protein Binding (PPB): | 30.96% |
Volume Distribution (VD): | 1.309 | Fu: | 69.71% |
CYP1A2-inhibitor: | 0.215 | CYP1A2-substrate: | 0.539 |
CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.481 |
CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.097 |
CYP2D6-inhibitor: | 0.069 | CYP2D6-substrate: | 0.44 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.383 |
Clearance (CL): | 4.792 | Half-life (T1/2): | 0.874 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.023 |
Drug-inuced Liver Injury (DILI): | 0.064 | AMES Toxicity: | 0.094 |
Rat Oral Acute Toxicity: | 0.404 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.18 | Carcinogencity: | 0.039 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.968 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005498 | 0.450 | D05OIS | 0.395 | ||||
ENC000754 | 0.450 | D0T3LF | 0.349 | ||||
ENC000365 | 0.425 | D05BMG | 0.349 | ||||
ENC000173 | 0.415 | D0LG8E | 0.340 | ||||
ENC000407 | 0.410 | D00HHS | 0.340 | ||||
ENC000746 | 0.409 | D02YYF | 0.327 | ||||
ENC001934 | 0.395 | D0P6UB | 0.326 | ||||
ENC001960 | 0.395 | D07HBX | 0.326 | ||||
ENC000409 | 0.395 | D04EYC | 0.319 | ||||
ENC000014 | 0.395 | D0O6IU | 0.313 |