NPs Basic Information
|
Name |
5,7-Dimethylundecane
|
| Molecular Formula | C13H28 | |
| IUPAC Name* |
5,7-dimethylundecane
|
|
| SMILES |
CCCCC(C)CC(C)CCCC
|
|
| InChI |
InChI=1S/C13H28/c1-5-7-9-12(3)11-13(4)10-8-6-2/h12-13H,5-11H2,1-4H3
|
|
| InChIKey |
AMMTZOCUKBWLJL-UHFFFAOYSA-N
|
|
| Synonyms |
5,7-Dimethylundecane; Undecane, 5,7-dimethyl-; 17312-83-3; UNDECANE5,7-DIMETHYL; 5,7-Dimethylundecane #; DTXSID50334004; LMFA11000695
|
|
| CAS | 17312-83-3 | |
| PubChem CID | 519405 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 184.36 | ALogp: | 6.7 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
| Heavy Atoms: | 13 | QED Weighted: | 0.476 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.382 | MDCK Permeability: | 0.00001110 |
| Pgp-inhibitor: | 0.036 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.571 |
| 30% Bioavailability (F30%): | 0.933 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.535 | Plasma Protein Binding (PPB): | 97.71% |
| Volume Distribution (VD): | 2.997 | Fu: | 2.32% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.88 | CYP1A2-substrate: | 0.367 |
| CYP2C19-inhibitor: | 0.527 | CYP2C19-substrate: | 0.813 |
| CYP2C9-inhibitor: | 0.486 | CYP2C9-substrate: | 0.894 |
| CYP2D6-inhibitor: | 0.079 | CYP2D6-substrate: | 0.061 |
| CYP3A4-inhibitor: | 0.197 | CYP3A4-substrate: | 0.125 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 8.298 | Half-life (T1/2): | 0.127 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.016 |
| Drug-inuced Liver Injury (DILI): | 0.108 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.023 |
| Skin Sensitization: | 0.901 | Carcinogencity: | 0.047 |
| Eye Corrosion: | 0.992 | Eye Irritation: | 0.967 |
| Respiratory Toxicity: | 0.26 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001174 |  |
0.811 | D0X4FM |  |
0.294 | ||
| ENC001241 |  |
0.738 | D03LGY |  |
0.275 | ||
| ENC001131 |  |
0.667 | D0Y3KG |  |
0.271 | ||
| ENC001247 |  |
0.635 | D0N3NO |  |
0.267 | ||
| ENC001128 |  |
0.628 | D0ZI4H |  |
0.267 | ||
| ENC001129 |  |
0.595 | D0T9TJ |  |
0.231 | ||
| ENC000769 |  |
0.591 | D00FSV |  |
0.223 | ||
| ENC000628 |  |
0.591 | D01QLH |  |
0.213 | ||
| ENC001207 |  |
0.568 | D06ORU |  |
0.213 | ||
| ENC000582 |  |
0.558 | D0AY9Q |  |
0.203 | ||