|
Name |
Angustine
|
Molecular Formula | C20H15N3O | |
IUPAC Name* |
19-ethenyl-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one
|
|
SMILES |
C=CC1=CN=CC2=C1C=C3C4=C(CCN3C2=O)C5=CC=CC=C5N4
|
|
InChI |
InChI=1S/C20H15N3O/c1-2-12-10-21-11-16-15(12)9-18-19-14(7-8-23(18)20(16)24)13-5-3-4-6-17(13)22-19/h2-6,9-11,22H,1,7-8H2
|
|
InChIKey |
FACXQEOSOVJIPD-UHFFFAOYSA-N
|
|
Synonyms |
Angustine; 40041-96-1; ACon1_001438; C09032; 19-ethenyl-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one; AC1L9C1T; Angustin; SureCN2953015; CHEBI:2725; SCHEMBL2953015; DTXSID20193105; BRD-K36899820-001-01-4; Q27105783; Indolo(2',3':3,4)pyrido(1,2-b)(2,7)naphthyridin-5(7H)-one, 1-ethenyl-8,13-dihydro-
|
|
CAS | 40041-96-1 | |
PubChem CID | 441983 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 313.4 | ALogp: | 3.1 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 24 | QED Weighted: | 0.565 |
Caco-2 Permeability: | -5.173 | MDCK Permeability: | 0.00001540 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.042 |
30% Bioavailability (F30%): | 0.017 |
Blood-Brain-Barrier Penetration (BBB): | 0.785 | Plasma Protein Binding (PPB): | 95.46% |
Volume Distribution (VD): | 1.435 | Fu: | 2.72% |
CYP1A2-inhibitor: | 0.987 | CYP1A2-substrate: | 0.619 |
CYP2C19-inhibitor: | 0.881 | CYP2C19-substrate: | 0.122 |
CYP2C9-inhibitor: | 0.831 | CYP2C9-substrate: | 0.926 |
CYP2D6-inhibitor: | 0.757 | CYP2D6-substrate: | 0.917 |
CYP3A4-inhibitor: | 0.92 | CYP3A4-substrate: | 0.345 |
Clearance (CL): | 6.421 | Half-life (T1/2): | 0.162 |
hERG Blockers: | 0.633 | Human Hepatotoxicity (H-HT): | 0.803 |
Drug-inuced Liver Injury (DILI): | 0.899 | AMES Toxicity: | 0.958 |
Rat Oral Acute Toxicity: | 0.456 | Maximum Recommended Daily Dose: | 0.915 |
Skin Sensitization: | 0.638 | Carcinogencity: | 0.719 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.181 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002323 | 0.390 | D05MQK | 0.316 | ||||
ENC002154 | 0.371 | D0U7GP | 0.283 | ||||
ENC002939 | 0.349 | D01JGV | 0.283 | ||||
ENC000663 | 0.346 | D06GKN | 0.279 | ||||
ENC006010 | 0.345 | D08VRO | 0.275 | ||||
ENC002699 | 0.319 | D01SHZ | 0.264 | ||||
ENC000858 | 0.319 | D0H4JM | 0.261 | ||||
ENC003571 | 0.316 | D0Z5OV | 0.257 | ||||
ENC002926 | 0.315 | D0O7JW | 0.257 | ||||
ENC004695 | 0.312 | D0R1JV | 0.256 |