|
Name |
brevianamide K
|
Molecular Formula | C21H21N3O2 | |
IUPAC Name* |
(3Z)-3-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]-6,7-dihydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
CC(C)(C=C)C1=C(C2=CC=CC=C2N1)/C=C\3/C(=O)N4CCC=C4C(=O)N3
|
|
InChI |
InChI=1S/C21H21N3O2/c1-4-21(2,3)18-14(13-8-5-6-9-15(13)22-18)12-16-20(26)24-11-7-10-17(24)19(25)23-16/h4-6,8-10,12,22H,1,7,11H2,2-3H3,(H,23,25)/b16-12-
|
|
InChIKey |
VLLSKMDBWJJQDE-VBKFSLOCSA-N
|
|
Synonyms |
brevianamide K; (3Z)-3-[[2-(1,1-dimethylallyl)-1H-indol-3-yl]methylene]-6,7-dihydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
CAS | NA | |
PubChem CID | 71596533 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 347.4 | ALogp: | 3.7 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 65.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.712 |
Caco-2 Permeability: | -5.386 | MDCK Permeability: | 0.00001730 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.105 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.064 | Plasma Protein Binding (PPB): | 96.19% |
Volume Distribution (VD): | 0.835 | Fu: | 1.24% |
CYP1A2-inhibitor: | 0.972 | CYP1A2-substrate: | 0.873 |
CYP2C19-inhibitor: | 0.891 | CYP2C19-substrate: | 0.279 |
CYP2C9-inhibitor: | 0.803 | CYP2C9-substrate: | 0.917 |
CYP2D6-inhibitor: | 0.718 | CYP2D6-substrate: | 0.85 |
CYP3A4-inhibitor: | 0.943 | CYP3A4-substrate: | 0.632 |
Clearance (CL): | 3.405 | Half-life (T1/2): | 0.273 |
hERG Blockers: | 0.135 | Human Hepatotoxicity (H-HT): | 0.504 |
Drug-inuced Liver Injury (DILI): | 0.731 | AMES Toxicity: | 0.773 |
Rat Oral Acute Toxicity: | 0.956 | Maximum Recommended Daily Dose: | 0.954 |
Skin Sensitization: | 0.541 | Carcinogencity: | 0.92 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.067 |
Respiratory Toxicity: | 0.962 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002446 | 0.655 | D01PZD | 0.278 | ||||
ENC002925 | 0.570 | D05MQK | 0.276 | ||||
ENC004932 | 0.570 | D06GKN | 0.271 | ||||
ENC002714 | 0.558 | D0W7WC | 0.269 | ||||
ENC004441 | 0.546 | D08VRO | 0.268 | ||||
ENC004440 | 0.546 | D01JGV | 0.254 | ||||
ENC005569 | 0.544 | D0U7GP | 0.254 | ||||
ENC001957 | 0.544 | D0AV3G | 0.250 | ||||
ENC004928 | 0.542 | D08EOD | 0.239 | ||||
ENC002715 | 0.541 | D03GET | 0.239 |