|
Name |
Cyclohexane, (1-methylethylidene)-
|
Molecular Formula | C9H16 | |
IUPAC Name* |
propan-2-ylidenecyclohexane
|
|
SMILES |
CC(=C1CCCCC1)C
|
|
InChI |
InChI=1S/C9H16/c1-8(2)9-6-4-3-5-7-9/h3-7H2,1-2H3
|
|
InChIKey |
CUYJYVAWBJXBIC-UHFFFAOYSA-N
|
|
Synonyms |
Cyclohexane, (1-methylethylidene)-; Cyclohexane, isopropylidene-; Isopropylidenecyclohexane; 5749-72-4; (1-Methylethylidene)cyclohexane; DTXSID40206100; (1-Methylethylidene)cyclohexane #
|
|
CAS | 5749-72-4 | |
PubChem CID | 138578 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 124.22 | ALogp: | 3.5 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.427 |
Caco-2 Permeability: | -4.383 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.955 |
30% Bioavailability (F30%): | 0.311 |
Blood-Brain-Barrier Penetration (BBB): | 0.705 | Plasma Protein Binding (PPB): | 97.07% |
Volume Distribution (VD): | 5.097 | Fu: | 2.46% |
CYP1A2-inhibitor: | 0.951 | CYP1A2-substrate: | 0.552 |
CYP2C19-inhibitor: | 0.39 | CYP2C19-substrate: | 0.521 |
CYP2C9-inhibitor: | 0.412 | CYP2C9-substrate: | 0.901 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.174 |
Clearance (CL): | 11.055 | Half-life (T1/2): | 0.367 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.12 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.468 | Carcinogencity: | 0.35 |
Eye Corrosion: | 0.794 | Eye Irritation: | 0.975 |
Respiratory Toxicity: | 0.177 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001712 | 0.381 | D0X1EZ | 0.275 | ||||
ENC000395 | 0.368 | D03DVJ | 0.244 | ||||
ENC001813 | 0.269 | D03WAJ | 0.210 | ||||
ENC000518 | 0.267 | D0CK3G | 0.208 | ||||
ENC000251 | 0.265 | D0J0ZS | 0.208 | ||||
ENC000492 | 0.262 | D0X0WU | 0.206 | ||||
ENC001341 | 0.256 | D07GRH | 0.196 | ||||
ENC001165 | 0.256 | D0E6YQ | 0.190 | ||||
ENC001082 | 0.256 | D0D0GV | 0.185 | ||||
ENC000450 | 0.250 | D00ETS | 0.183 |