|
Name |
2-Butenal, 2-methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-
|
Molecular Formula | C14H22O | |
IUPAC Name* |
2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-enal
|
|
SMILES |
CC1=CCCC(C1CC=C(C)C=O)(C)C
|
|
InChI |
InChI=1S/C14H22O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h6-7,10,13H,5,8-9H2,1-4H3
|
|
InChIKey |
JJHZLPJQTHPGEI-UHFFFAOYSA-N
|
|
Synonyms |
2-Butenal, 2-methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-; 68555-62-4; SCHEMBL9016197; DTXSID60867676
|
|
CAS | 68555-62-4 | |
PubChem CID | 109470 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 206.32 | ALogp: | 3.4 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.376 |
Caco-2 Permeability: | -4.423 | MDCK Permeability: | 0.00001890 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.818 |
30% Bioavailability (F30%): | 0.201 |
Blood-Brain-Barrier Penetration (BBB): | 0.611 | Plasma Protein Binding (PPB): | 93.37% |
Volume Distribution (VD): | 2.441 | Fu: | 6.13% |
CYP1A2-inhibitor: | 0.239 | CYP1A2-substrate: | 0.583 |
CYP2C19-inhibitor: | 0.6 | CYP2C19-substrate: | 0.895 |
CYP2C9-inhibitor: | 0.336 | CYP2C9-substrate: | 0.953 |
CYP2D6-inhibitor: | 0.037 | CYP2D6-substrate: | 0.865 |
CYP3A4-inhibitor: | 0.124 | CYP3A4-substrate: | 0.24 |
Clearance (CL): | 5.226 | Half-life (T1/2): | 0.231 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.426 |
Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.718 |
Skin Sensitization: | 0.532 | Carcinogencity: | 0.213 |
Eye Corrosion: | 0.984 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.943 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001316 | 0.350 | D0S7WX | 0.244 | ||||
ENC001457 | 0.327 | D00DKK | 0.222 | ||||
ENC002306 | 0.308 | D0G3PI | 0.222 | ||||
ENC001836 | 0.306 | D02DGU | 0.222 | ||||
ENC001827 | 0.306 | D0H1QY | 0.211 | ||||
ENC002073 | 0.306 | D0W6DG | 0.210 | ||||
ENC000770 | 0.306 | D0H6VY | 0.206 | ||||
ENC000332 | 0.306 | D04GJN | 0.187 | ||||
ENC005922 | 0.294 | D0A2AJ | 0.184 | ||||
ENC003367 | 0.292 | D0B4RU | 0.182 |