|
Name |
Fumitremorgin A
|
Molecular Formula | C32H41N3O7 | |
IUPAC Name* |
(9R,14S,17S,23R,24S)-23-hydroxy-5-methoxy-12,12-dimethyl-24-(3-methylbut-2-enoxy)-9-(2-methylprop-1-enyl)-10,11-dioxa-8,15,21-triazahexacyclo[12.10.1.02,7.08,25.015,23.017,21]pentacosa-1(25),2(7),3,5-tetraene-16,22-dione
|
|
SMILES |
CC(=CCO[C@H]1C2=C3[C@H](CC(OO[C@@H](N3C4=C2C=CC(=C4)OC)C=C(C)C)(C)C)N5[C@@]1(C(=O)N6CCC[C@H]6C5=O)O)C
|
|
InChI |
InChI=1S/C32H41N3O7/c1-18(2)12-14-40-28-26-21-11-10-20(39-7)16-23(21)34-25(15-19(3)4)41-42-31(5,6)17-24(27(26)34)35-29(36)22-9-8-13-33(22)30(37)32(28,35)38/h10-12,15-16,22,24-25,28,38H,8-9,13-14,17H2,1-7H3/t22-,24-,25+,28-,32+/m0/s1
|
|
InChIKey |
ACGHJVZDNQZJOV-BMOJZYMJSA-N
|
|
Synonyms |
Fumitremorgin A; 12626-18-5; ZR1C7949XT; (9R,14S,17S,23R,24S)-23-hydroxy-5-methoxy-12,12-dimethyl-24-(3-methylbut-2-enoxy)-9-(2-methylprop-1-enyl)-10,11-dioxa-8,15,21-triazahexacyclo[12.10.1.02,7.08,25.015,23.017,21]pentacosa-1(25),2(7),3,5-tetraene-16,22-dione; (5R,10S,10aR,14aS,15bS)-10a-hydroxy-7-methoxy-2,2-dimethyl-10-[(3-methylbut-2-en-1-yl)oxy]-5-(2-methylprop-1-en-1-yl)-1,10,10a,14,14a,15b-hexahydro-12H-3,4-dioxa-5a,11a,15a-triazacycloocta[1,2,3-lm]indeno[5,6-b]fluorene-11,15(H,13H)-dione; UNII-ZR1C7949XT; FUMITREMORGEN A; SCHEMBL1887086; ACon1_001759; CHEBI:72766; BRD8008; DTXSID30925479; BRD-8008; ZINC38139608; NCGC00180170-01; NCGC00180170-02; 5H-12H-3,4-Dioxa-5a,11a,15a-triazacyclooct(lm)indeno(5,6-b)fluorene-11,15(2H,13H)-dione, 1,10,10a,14,14a,15b-hexahydro-10a-hydroxy-7-methoxy-2,2-dimethyl-10-((3-methyl-2-butenyl)oxy)-5-(2-methyl-1-propenyl)-, (5R,10S,10aR,14aS,15bS)-; 5H-12H-3,4-Dioxa-5a,11a,15a-triazacyclooct(lm)indeno(5,6-b)fluorene-11,15(2H,13H)-dione, 1,10,10a,14,14a,15b-hexahydro-10a-hydroxy-7-methoxy-2,2-dimethyl-10-((3-methyl-2-butenyl)oxy)-5-(2-methyl-1-propenyl)-, (5R-(5-alpha,10-alpha,10a-alpha,14a-alpha,15b-alpha))-; C20564; BRD-K19808008-001-01-0; Q27140132; NCGC00180170-02_C32H41N3O7_5H,12H-3,4-Dioxa-5a,11a,15a-triazacyclooct[lm]indeno[5,6-b]fluorene-11,15(2H,13H)-dione, 1,10,10a,14,14a,15b-hexahydro-10a-hydroxy-7-methoxy-2,2-dimethyl-10-[(3-methyl-2-buten-1-yl)oxy]-5-(2-methyl-1-propen-1-yl)-, (5R,10S,10aR,14aS,15bS)-
|
|
CAS | 12626-18-5 | |
PubChem CID | 107713 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 579.7 | ALogp: | 3.8 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 103.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 42 | QED Weighted: | 0.382 |
Caco-2 Permeability: | -4.743 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.764 |
Human Intestinal Absorption (HIA): | 0.051 | 20% Bioavailability (F20%): | 0.169 |
30% Bioavailability (F30%): | 0.841 |
Blood-Brain-Barrier Penetration (BBB): | 0.453 | Plasma Protein Binding (PPB): | 90.43% |
Volume Distribution (VD): | 1.304 | Fu: | 4.14% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.119 |
CYP2C19-inhibitor: | 0.634 | CYP2C19-substrate: | 0.923 |
CYP2C9-inhibitor: | 0.826 | CYP2C9-substrate: | 0.46 |
CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.136 |
CYP3A4-inhibitor: | 0.745 | CYP3A4-substrate: | 0.94 |
Clearance (CL): | 9.59 | Half-life (T1/2): | 0.107 |
hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.997 |
Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.062 |
Rat Oral Acute Toxicity: | 0.034 | Maximum Recommended Daily Dose: | 0.991 |
Skin Sensitization: | 0.271 | Carcinogencity: | 0.169 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.653 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002260 | 0.787 | D06YFA | 0.263 | ||||
ENC000837 | 0.594 | D02IQY | 0.257 | ||||
ENC003281 | 0.536 | D01TSI | 0.245 | ||||
ENC003265 | 0.507 | D0Q0PR | 0.243 | ||||
ENC003264 | 0.474 | D0V3ZA | 0.238 | ||||
ENC001958 | 0.474 | D0SP3D | 0.233 | ||||
ENC002846 | 0.437 | D09NNH | 0.232 | ||||
ENC005479 | 0.436 | D06HBQ | 0.230 | ||||
ENC003013 | 0.406 | D0G8NJ | 0.230 | ||||
ENC002274 | 0.403 | D0Y5RZ | 0.225 |