|
Name |
Cyclotryprostatin E
|
Molecular Formula | C23H29N3O6 | |
IUPAC Name* |
(1S,2S,12S,15S)-1-hydroxy-12-(2-hydroxy-2-methylpropyl)-2,7-dimethoxy-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione
|
|
SMILES |
CC(C)(C[C@H]1C2=C([C@@H]([C@]3(N1C(=O)[C@@H]4CCCN4C3=O)O)OC)C5=C(N2)C=C(C=C5)OC)O
|
|
InChI |
InChI=1S/C23H29N3O6/c1-22(2,29)11-16-18-17(13-8-7-12(31-3)10-14(13)24-18)19(32-4)23(30)21(28)25-9-5-6-15(25)20(27)26(16)23/h7-8,10,15-16,19,24,29-30H,5-6,9,11H2,1-4H3/t15-,16-,19-,23-/m0/s1
|
|
InChIKey |
IQQGHQDLZFLSGU-YZQOHXRLSA-N
|
|
Synonyms |
Cyclotryprostatin E; CHEMBL2229116; 12beta-hydroxy-13alpha-methoxyverruculogen TR-2
|
|
CAS | NA | |
PubChem CID | 56954715 | |
ChEMBL ID | CHEMBL2229116 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 443.5 | ALogp: | 0.3 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 115.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 32 | QED Weighted: | 0.667 |
Caco-2 Permeability: | -4.969 | MDCK Permeability: | 0.00000895 |
Pgp-inhibitor: | 0.889 | Pgp-substrate: | 0.155 |
Human Intestinal Absorption (HIA): | 0.033 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.785 |
Blood-Brain-Barrier Penetration (BBB): | 0.254 | Plasma Protein Binding (PPB): | 49.04% |
Volume Distribution (VD): | 1.215 | Fu: | 40.93% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.118 |
CYP2C19-inhibitor: | 0.104 | CYP2C19-substrate: | 0.821 |
CYP2C9-inhibitor: | 0.291 | CYP2C9-substrate: | 0.493 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.184 |
CYP3A4-inhibitor: | 0.43 | CYP3A4-substrate: | 0.934 |
Clearance (CL): | 9.001 | Half-life (T1/2): | 0.322 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.804 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.628 | Maximum Recommended Daily Dose: | 0.961 |
Skin Sensitization: | 0.381 | Carcinogencity: | 0.127 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.946 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003013 | 0.840 | D06YFA | 0.286 | ||||
ENC003265 | 0.740 | D0J4JM | 0.285 | ||||
ENC001958 | 0.629 | D02IQY | 0.278 | ||||
ENC003264 | 0.629 | D0G8NJ | 0.275 | ||||
ENC000837 | 0.484 | D0C6DT | 0.260 | ||||
ENC001060 | 0.478 | D01XNB | 0.260 | ||||
ENC002274 | 0.478 | D01TSI | 0.256 | ||||
ENC002064 | 0.469 | D0SP3D | 0.249 | ||||
ENC005479 | 0.466 | D09NNH | 0.249 | ||||
ENC002698 | 0.456 | D0V3ZA | 0.249 |