|
Name |
Nopyl acetate
|
Molecular Formula | C13H20O2 | |
IUPAC Name* |
2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl acetate
|
|
SMILES |
CC(=O)OCCC1=CCC2CC1C2(C)C
|
|
InChI |
InChI=1S/C13H20O2/c1-9(14)15-7-6-10-4-5-11-8-12(10)13(11,2)3/h4,11-12H,5-8H2,1-3H3
|
|
InChIKey |
AWNOGHRWORTNEI-UHFFFAOYSA-N
|
|
Synonyms |
Nopyl acetate; 128-51-8; Nopol acetate; Citroviol; Lignyl acetate; Bicyclo[3.1.1]hept-2-ene-2-ethanol, 6,6-dimethyl-, acetate; Nopyl acetate, (-)-; 2-Pinene-10-methyl acetate; 6, acetate; 6,6-Dimethylbicyclo(3.1.1)-2-heptene-2-ethyl acetate; 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethyl acetate; 2-(6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl)ethyl acetate; 6,6-Dimethyl-2-norpinene-2-ethanol, acetate; WLN: L46 EUTJ C1 C1 E2OV1; 6165-23-7; Bicyclo[3.1.1]hept-2-ene-2-ethanol, 6,6-dimethyl-, 2-acetate; 2-Norpinene-2-ethanol,6-dimethyl-, acetate; 6,6-Dimethylbicyclo[3.1.1]-2-heptene-2-ethyl acetate; Bicyclo[3.1.1]hept-2-ene-2-ethanol,6-dimethyl-, acetate; Nopylacetate; 2-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}ethyl acetate; NSC-1286; 2-(6,6-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)ethyl acetate; NSC-404963; SCHEMBL132597; CHEMBL257347; DTXSID70977235; NSC1286; NSC404963; STL570065; AKOS030513519; 6,6- Dimethylbicyclo-(3,1,1)- 2-heptene-2 ethylacetate; 2-(6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl)ethyl acetate #
|
|
CAS | 128-51-8 | |
PubChem CID | 101604 | |
ChEMBL ID | CHEMBL257347 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.3 | ALogp: | 2.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 15 | QED Weighted: | 0.522 |
Caco-2 Permeability: | -4.403 | MDCK Permeability: | 0.00002760 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.662 |
30% Bioavailability (F30%): | 0.531 |
Blood-Brain-Barrier Penetration (BBB): | 0.986 | Plasma Protein Binding (PPB): | 49.24% |
Volume Distribution (VD): | 1.079 | Fu: | 49.20% |
CYP1A2-inhibitor: | 0.348 | CYP1A2-substrate: | 0.102 |
CYP2C19-inhibitor: | 0.335 | CYP2C19-substrate: | 0.571 |
CYP2C9-inhibitor: | 0.315 | CYP2C9-substrate: | 0.58 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.485 |
CYP3A4-inhibitor: | 0.104 | CYP3A4-substrate: | 0.244 |
Clearance (CL): | 7.157 | Half-life (T1/2): | 0.14 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.041 |
Drug-inuced Liver Injury (DILI): | 0.159 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.428 |
Skin Sensitization: | 0.08 | Carcinogencity: | 0.359 |
Eye Corrosion: | 0.425 | Eye Irritation: | 0.939 |
Respiratory Toxicity: | 0.846 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000153 | 0.478 | D0Q9HF | 0.294 | ||||
ENC003152 | 0.386 | D02CNR | 0.229 | ||||
ENC000770 | 0.367 | D02CJX | 0.221 | ||||
ENC001827 | 0.367 | D05VQI | 0.215 | ||||
ENC004750 | 0.350 | D0X4RS | 0.212 | ||||
ENC005458 | 0.338 | D05MPX | 0.209 | ||||
ENC000613 | 0.333 | D0B4RU | 0.207 | ||||
ENC001811 | 0.310 | D0H1QY | 0.207 | ||||
ENC000482 | 0.308 | D09WYX | 0.206 | ||||
ENC000603 | 0.306 | D01ZOG | 0.200 |