|
Name |
Violaceol i
|
Molecular Formula | C14H14O5 | |
IUPAC Name* |
3-(2,3-dihydroxy-5-methylphenoxy)-5-methylbenzene-1,2-diol
|
|
SMILES |
CC1=CC(=C(C(=C1)OC2=CC(=CC(=C2O)O)C)O)O
|
|
InChI |
InChI=1S/C14H14O5/c1-7-3-9(15)13(17)11(5-7)19-12-6-8(2)4-10(16)14(12)18/h3-6,15-18H,1-2H3
|
|
InChIKey |
YRZXKRQRZJMBFT-UHFFFAOYSA-N
|
|
Synonyms |
violaceol i; 68027-81-6; ETHERICIN A; aspermutarubrol; Aspermutarubol; violaceol-I; violacerol-I; 3-(2,3-dihydroxy-5-methylphenoxy)-5-methylbenzene-1,2-diol; 6PZ85EB2LJ; CHEBI:64415; NSC-330927; 3,3'-Oxybis(5-methyl-1,2-benzenediol); 3,3'-oxybis(5-methylbenzene-1,2-diol); 3,3'-Oxybis[5-methyl-1,2-benzenediol]; NSC330927; 1,2-Benzenediol, 3,3'-oxybis(5-methyl-; UNII-6PZ85EB2LJ; MEGxm0_000129; CHEMBL2000711; ACon0_000595; ACon1_000731; DTXSID10218215; ZINC1574902; NSC 330927; NCGC00169413-01; NCI60_002901; Q27133271
|
|
CAS | 68027-81-6 | |
PubChem CID | 100615 | |
ChEMBL ID | CHEMBL2000711 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 262.26 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 90.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.619 |
Caco-2 Permeability: | -5.028 | MDCK Permeability: | 0.00001220 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.046 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.981 |
30% Bioavailability (F30%): | 0.936 |
Blood-Brain-Barrier Penetration (BBB): | 0.014 | Plasma Protein Binding (PPB): | 96.80% |
Volume Distribution (VD): | 0.485 | Fu: | 2.39% |
CYP1A2-inhibitor: | 0.8 | CYP1A2-substrate: | 0.864 |
CYP2C19-inhibitor: | 0.119 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.411 | CYP2C9-substrate: | 0.349 |
CYP2D6-inhibitor: | 0.487 | CYP2D6-substrate: | 0.45 |
CYP3A4-inhibitor: | 0.082 | CYP3A4-substrate: | 0.23 |
Clearance (CL): | 15.812 | Half-life (T1/2): | 0.927 |
hERG Blockers: | 0.055 | Human Hepatotoxicity (H-HT): | 0.041 |
Drug-inuced Liver Injury (DILI): | 0.216 | AMES Toxicity: | 0.114 |
Rat Oral Acute Toxicity: | 0.375 | Maximum Recommended Daily Dose: | 0.894 |
Skin Sensitization: | 0.968 | Carcinogencity: | 0.36 |
Eye Corrosion: | 0.557 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.689 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002368 | 0.759 | D04AIT | 0.313 | ||||
ENC005122 | 0.591 | D0K8KX | 0.306 | ||||
ENC005123 | 0.591 | D07MGA | 0.302 | ||||
ENC003748 | 0.466 | D06GCK | 0.277 | ||||
ENC002783 | 0.449 | D0U3YB | 0.276 | ||||
ENC005447 | 0.431 | D0Y7PG | 0.265 | ||||
ENC005344 | 0.423 | D00CSQ | 0.256 | ||||
ENC005416 | 0.420 | D07EXH | 0.250 | ||||
ENC002107 | 0.410 | D0S5CH | 0.247 | ||||
ENC002591 | 0.408 | D06RGG | 0.237 |